2-[4-[6,16-Dihydroxy-7,9,13-trimethyl-14-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-en-6-yl]-2-methylbutoxy]-6-(hydroxymethyl)oxane-3,4,5-triol
Internal ID | e9df840c-9714-4d40-8b4b-6673679ecd6d |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | 2-[4-[6,16-dihydroxy-7,9,13-trimethyl-14-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-en-6-yl]-2-methylbutoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
SMILES (Canonical) | CC1C2C(CC3C2(CCC4C3CC=C5C4(C(CC(C5)O)OC6C(C(C(C(O6)CO)O)O)O)C)C)OC1(CCC(C)COC7C(C(C(C(O7)CO)O)O)O)O |
SMILES (Isomeric) | CC1C2C(CC3C2(CCC4C3CC=C5C4(C(CC(C5)O)OC6C(C(C(C(O6)CO)O)O)O)C)C)OC1(CCC(C)COC7C(C(C(C(O7)CO)O)O)O)O |
InChI | InChI=1S/C39H64O15/c1-17(16-50-35-33(47)31(45)29(43)25(14-40)51-35)7-10-39(49)18(2)28-24(54-39)13-23-21-6-5-19-11-20(42)12-27(38(19,4)22(21)8-9-37(23,28)3)53-36-34(48)32(46)30(44)26(15-41)52-36/h5,17-18,20-36,40-49H,6-16H2,1-4H3 |
InChI Key | NSNUSRJUPCLYHS-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C39H64O15 |
Molecular Weight | 772.90 g/mol |
Exact Mass | 772.42452133 g/mol |
Topological Polar Surface Area (TPSA) | 248.00 Ų |
XlogP | 0.50 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.29% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.00% | 91.11% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 96.38% | 95.93% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.57% | 97.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 92.54% | 100.00% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 90.73% | 90.17% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 90.55% | 93.56% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 89.45% | 95.89% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 89.24% | 96.61% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 89.23% | 92.86% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.03% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.00% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 86.92% | 98.95% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 86.63% | 97.25% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 85.68% | 89.05% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 85.40% | 98.35% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.36% | 94.45% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 85.08% | 97.79% |
CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 84.35% | 98.46% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.11% | 95.89% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 83.96% | 97.14% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 83.73% | 93.18% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.75% | 100.00% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 82.25% | 92.50% |
CHEMBL3401 | O75469 | Pregnane X receptor | 81.93% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Allium nutans |
Nolina microcarpa |
PubChem | 73814714 |
LOTUS | LTS0083377 |
wikiData | Q105185159 |