(1aS,7R,7aR,10aS,11aS)-1a,2,3,7a,8,10a,11,11a-Octahydro-11a-methyl-8-methylene-5H-7,4-methenofuro[3,2-c]oxireno[f]oxacycloundecin-5,9(7H)-dione
Internal ID | 2a5c1c8f-5f30-4783-b38a-2caa198fd421 |
Taxonomy | Organoheterocyclic compounds > Lactones > Gamma butyrolactones |
IUPAC Name | 8-methyl-3-methylidene-5,9,15-trioxatetracyclo[11.2.1.02,6.08,10]hexadec-13(16)-ene-4,14-dione |
SMILES (Canonical) | CC12CC3C(C4C=C(CCC1O2)C(=O)O4)C(=C)C(=O)O3 |
SMILES (Isomeric) | CC12CC3C(C4C=C(CCC1O2)C(=O)O4)C(=C)C(=O)O3 |
InChI | InChI=1S/C15H16O5/c1-7-12-9-5-8(14(17)18-9)3-4-11-15(2,20-11)6-10(12)19-13(7)16/h5,9-12H,1,3-4,6H2,2H3 |
InChI Key | XASRCIGCTSZFAS-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C15H16O5 |
Molecular Weight | 276.28 g/mol |
Exact Mass | 276.09977361 g/mol |
Topological Polar Surface Area (TPSA) | 65.10 Ų |
XlogP | 1.30 |
23753-57-3 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.11% | 95.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.90% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.37% | 97.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.41% | 100.00% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 85.98% | 91.11% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 85.14% | 97.14% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.11% | 96.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.90% | 95.89% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 83.87% | 93.40% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.77% | 86.33% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 82.33% | 90.17% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.23% | 99.23% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.21% | 89.00% |
CHEMBL1871 | P10275 | Androgen Receptor | 81.72% | 96.43% |
CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 81.03% | 94.78% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Mikania dusenii |
Mikania trachypleura |
Mikania urticifolia |
PubChem | 14081912 |
LOTUS | LTS0019299 |
wikiData | Q105324111 |