(5R)-4-[[7-hydroxy-3,5-dimethyl-6-[(E)-pent-3-enyl]-1-benzofuran-2-yl]methyl]-3,5-dimethyl-5,6,7,8-tetrahydrobenzo[f][1]benzofuran-9-ol
Internal ID | 42f477b9-80a6-4cd5-8896-be86e72d244d |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids > Eremophilane, 8,9-secoeremophilane and furoeremophilane sesquiterpenoids |
IUPAC Name | (5R)-4-[[7-hydroxy-3,5-dimethyl-6-[(E)-pent-3-enyl]-1-benzofuran-2-yl]methyl]-3,5-dimethyl-5,6,7,8-tetrahydrobenzo[f][1]benzofuran-9-ol |
SMILES (Canonical) | CC=CCCC1=C(C2=C(C=C1C)C(=C(O2)CC3=C4C(=COC4=C(C5=C3C(CCC5)C)O)C)C)O |
SMILES (Isomeric) | C/C=C/CCC1=C(C2=C(C=C1C)C(=C(O2)CC3=C4C(=COC4=C(C5=C3[C@@H](CCC5)C)O)C)C)O |
InChI | InChI=1S/C30H34O4/c1-6-7-8-11-20-17(3)13-22-19(5)24(34-29(22)27(20)31)14-23-25-16(2)10-9-12-21(25)28(32)30-26(23)18(4)15-33-30/h6-7,13,15-16,31-32H,8-12,14H2,1-5H3/b7-6+/t16-/m1/s1 |
InChI Key | VFMXYWPQDAJBMW-FYCOFBDGSA-N |
Popularity | 0 references in papers |
Molecular Formula | C30H34O4 |
Molecular Weight | 458.60 g/mol |
Exact Mass | 458.24570956 g/mol |
Topological Polar Surface Area (TPSA) | 66.70 Ų |
XlogP | 8.40 |
There are no found synonyms. |
![2D Structure of (5R)-4-[[7-hydroxy-3,5-dimethyl-6-[(E)-pent-3-enyl]-1-benzofuran-2-yl]methyl]-3,5-dimethyl-5,6,7,8-tetrahydrobenzo[f][1]benzofuran-9-ol 2D Structure of (5R)-4-[[7-hydroxy-3,5-dimethyl-6-[(E)-pent-3-enyl]-1-benzofuran-2-yl]methyl]-3,5-dimethyl-5,6,7,8-tetrahydrobenzo[f][1]benzofuran-9-ol](https://plantaedb.com/storage/docs/compounds/2023/11/df2b01c0-861a-11ee-b442-659a8169229f.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.87% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.25% | 89.00% |
CHEMBL4835 | P00338 | L-lactate dehydrogenase A chain | 92.11% | 95.34% |
CHEMBL2581 | P07339 | Cathepsin D | 91.19% | 98.95% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 89.97% | 91.49% |
CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 89.18% | 97.31% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.80% | 97.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.19% | 86.33% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 87.86% | 83.57% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.52% | 95.89% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 87.02% | 92.94% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 85.83% | 95.58% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.01% | 99.17% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.46% | 95.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.54% | 94.45% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.07% | 90.71% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 81.01% | 95.17% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.42% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ligularia virgaurea |
PubChem | 163191334 |
LOTUS | LTS0111497 |
wikiData | Q105285442 |