10,13-Dihydroxy-8,14-dioxapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(19),2,4,6,9,11,16(20),17-octaen-15-one
| Internal ID | abdcb9f7-8b01-4970-a691-e746dae21162 |
| Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Xanthenes > Benzoxanthenes |
| IUPAC Name | 10,13-dihydroxy-8,14-dioxapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(19),2,4,6,9,11,16(20),17-octaen-15-one |
| SMILES (Canonical) | C1=CC=C2C(=C1)C3=C4C5=C(C=C3)C(=O)OC(C5=CC(=C4O2)O)O |
| SMILES (Isomeric) | C1=CC=C2C(=C1)C3=C4C5=C(C=C3)C(=O)OC(C5=CC(=C4O2)O)O |
| InChI | InChI=1S/C18H10O5/c19-12-7-11-14-10(17(20)23-18(11)21)6-5-9-8-3-1-2-4-13(8)22-16(12)15(9)14/h1-7,18-19,21H |
| InChI Key | YKOZPDXFYYNZLM-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C18H10O5 |
| Molecular Weight | 306.30 g/mol |
| Exact Mass | 306.05282342 g/mol |
| Topological Polar Surface Area (TPSA) | 76.00 Ų |
| XlogP | 2.90 |
| There are no found synonyms. |
![2D Structure of 10,13-Dihydroxy-8,14-dioxapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(19),2,4,6,9,11,16(20),17-octaen-15-one](https://plantaedb.com/storage/docs/compounds/2023/11/df106ac0-865d-11ee-8e94-815ebc3e50ae.jpg "2D Structure of 10,13-Dihydroxy-8,14-dioxapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(19),2,4,6,9,11,16(20),17-octaen-15-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.60% | 91.11% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.33% | 89.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.63% | 95.56% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 94.30% | 99.23% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.61% | 98.95% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 93.13% | 91.49% |
| CHEMBL4530 | P00488 | Coagulation factor XIII | 83.73% | 96.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.48% | 99.15% |
| CHEMBL2535 | P11166 | Glucose transporter | 83.44% | 98.75% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.64% | 94.00% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 81.42% | 96.67% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 81.15% | 94.73% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 80.95% | 93.65% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Xiphidium caeruleum |
| PubChem | 11088082 |
| LOTUS | LTS0074518 |
| wikiData | Q105349819 |