Destruxin-E diol
| Internal ID | 58cdb912-c49e-4c04-9b8d-75db9a456eac |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Depsipeptides > Cyclic depsipeptides |
| IUPAC Name | 16-butan-2-yl-3-(2,3-dihydroxypropyl)-10,11,14-trimethyl-13-propan-2-yl-4-oxa-1,8,11,14,17-pentazabicyclo[17.3.0]docosane-2,5,9,12,15,18-hexone |
| SMILES (Canonical) | CCC(C)C1C(=O)N(C(C(=O)N(C(C(=O)NCCC(=O)OC(C(=O)N2CCCC2C(=O)N1)CC(CO)O)C)C)C(C)C)C |
| SMILES (Isomeric) | CCC(C)C1C(=O)N(C(C(=O)N(C(C(=O)NCCC(=O)OC(C(=O)N2CCCC2C(=O)N1)CC(CO)O)C)C)C(C)C)C |
| InChI | InChI=1S/C29H49N5O9/c1-8-17(4)23-28(41)33(7)24(16(2)3)29(42)32(6)18(5)25(38)30-12-11-22(37)43-21(14-19(36)15-35)27(40)34-13-9-10-20(34)26(39)31-23/h16-21,23-24,35-36H,8-15H2,1-7H3,(H,30,38)(H,31,39) |
| InChI Key | DJYDCIUMNXZSBH-UHFFFAOYSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C29H49N5O9 |
| Molecular Weight | 611.70 g/mol |
| Exact Mass | 611.35302816 g/mol |
| Topological Polar Surface Area (TPSA) | 186.00 Ų |
| XlogP | 0.20 |
| AKOS040739497 |
| NCGC00381220-02 |
| NCGC00381220-01!16-butan-2-yl-3-(2,3-dihydroxypropyl)-10,11,14-trimethyl-13-propan-2-yl-4-oxa-1,8,11,14,17-pentazabicyclo[17.3.0]docosane-2,5,9,12,15,18-hexone |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.25% | 98.95% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.72% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.67% | 96.09% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 96.69% | 90.08% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 95.50% | 94.66% |
| CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 94.48% | 96.31% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.39% | 85.14% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.58% | 97.09% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.57% | 95.89% |
| CHEMBL1902 | P62942 | FK506-binding protein 1A | 90.02% | 97.05% |
| CHEMBL332 | P03956 | Matrix metalloproteinase-1 | 89.35% | 94.50% |
| CHEMBL2189110 | Q15910 | Histone-lysine N-methyltransferase EZH2 | 88.39% | 97.50% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.91% | 90.71% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 87.79% | 94.75% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 87.44% | 92.97% |
| CHEMBL4616 | Q92847 | Ghrelin receptor | 87.29% | 92.00% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 87.19% | 98.59% |
| CHEMBL228 | P31645 | Serotonin transporter | 86.22% | 95.51% |
| CHEMBL3837 | P07711 | Cathepsin L | 85.68% | 96.61% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 85.40% | 82.38% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 85.38% | 93.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.23% | 89.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.71% | 95.56% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 84.11% | 95.62% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 83.95% | 95.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 83.64% | 91.11% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 83.21% | 96.47% |
| CHEMBL3691 | Q13822 | Autotaxin | 83.19% | 96.39% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 82.90% | 88.56% |
| CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 82.65% | 97.47% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 81.80% | 99.18% |
| CHEMBL325 | Q13547 | Histone deacetylase 1 | 81.73% | 95.92% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 81.48% | 100.00% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 81.31% | 98.03% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 81.27% | 91.03% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 81.09% | 93.56% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.01% | 94.45% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 81.00% | 95.50% |
| CHEMBL2443 | P49862 | Kallikrein 7 | 80.92% | 94.00% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 80.69% | 90.24% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.64% | 86.33% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.55% | 100.00% |
| CHEMBL321 | P14780 | Matrix metalloproteinase 9 | 80.49% | 92.12% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.46% | 99.23% |
| CHEMBL1949 | P62937 | Cyclophilin A | 80.46% | 98.57% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 80.36% | 90.00% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 80.13% | 97.79% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 3804245 |
| LOTUS | LTS0069492 |
| wikiData | Q103818455 |