Desmethylisoxanthohumol
Internal ID | 16c0e442-1c6d-475a-a56d-adaf96c87134 |
Taxonomy | Phenylpropanoids and polyketides > Linear 1,3-diarylpropanoids > Chalcones and dihydrochalcones > 3-prenylated chalcones |
IUPAC Name | (E)-3-phenyl-1-[2,4,6-trihydroxy-3-(3-methylbut-2-enyl)phenyl]prop-2-en-1-one |
SMILES (Canonical) | CC(=CCC1=C(C(=C(C=C1O)O)C(=O)C=CC2=CC=CC=C2)O)C |
SMILES (Isomeric) | CC(=CCC1=C(C(=C(C=C1O)O)C(=O)/C=C/C2=CC=CC=C2)O)C |
InChI | InChI=1S/C20H20O4/c1-13(2)8-10-15-17(22)12-18(23)19(20(15)24)16(21)11-9-14-6-4-3-5-7-14/h3-9,11-12,22-24H,10H2,1-2H3/b11-9+ |
InChI Key | HDFDQMFITYCMDM-PKNBQFBNSA-N |
Popularity | 2 references in papers |
Molecular Formula | C20H20O4 |
Molecular Weight | 324.40 g/mol |
Exact Mass | 324.13615911 g/mol |
Topological Polar Surface Area (TPSA) | 77.80 Ų |
XlogP | 5.10 |
(E)-3-phenyl-1-[2,4,6-trihydroxy-3-(3-methylbut-2-enyl)phenyl]prop-2-en-1-one |
2,4',6'-Trihydroxy-3'-prenylchalcone |
CHEMBL2203298 |
LMPK12120213 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.78% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.31% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 94.02% | 98.95% |
CHEMBL3401 | O75469 | Pregnane X receptor | 92.71% | 94.73% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 92.27% | 96.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.70% | 95.56% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 85.89% | 95.50% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 84.51% | 91.71% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 82.86% | 96.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.80% | 99.17% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 81.24% | 90.17% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 81.15% | 94.62% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.68% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Helichrysum athrixiifolium |
Helichrysum cymosum |
Helichrysum melanacme |
Metalasia cymbifolia |
Pleiotaxis rugosa |
PubChem | 11992148 |
LOTUS | LTS0062964 |
wikiData | Q105026315 |