Derrichalcone
Internal ID | 9220e065-85d4-43e2-95a9-7a176c95cad9 |
Taxonomy | Phenylpropanoids and polyketides > Linear 1,3-diarylpropanoids > Chalcones and dihydrochalcones > 2-Hydroxychalcones |
IUPAC Name | (E)-1-[(9R,10S)-5,10-dihydroxy-9-methoxy-2,2,8,8-tetramethyl-9,10-dihydropyrano[2,3-f]chromen-6-yl]-3-(4-hydroxyphenyl)prop-2-en-1-one |
SMILES (Canonical) | CC1(C=CC2=C(C(=C3C(=C2O1)C(C(C(O3)(C)C)OC)O)C(=O)C=CC4=CC=C(C=C4)O)O)C |
SMILES (Isomeric) | CC1(C=CC2=C(C(=C3C(=C2O1)[C@@H]([C@H](C(O3)(C)C)OC)O)C(=O)/C=C/C4=CC=C(C=C4)O)O)C |
InChI | InChI=1S/C26H28O7/c1-25(2)13-12-16-20(29)18(17(28)11-8-14-6-9-15(27)10-7-14)23-19(22(16)32-25)21(30)24(31-5)26(3,4)33-23/h6-13,21,24,27,29-30H,1-5H3/b11-8+/t21-,24+/m0/s1 |
InChI Key | LJHGFVOYNHBEEI-JSICGULGSA-N |
Popularity | 0 references in papers |
Molecular Formula | C26H28O7 |
Molecular Weight | 452.50 g/mol |
Exact Mass | 452.18350323 g/mol |
Topological Polar Surface Area (TPSA) | 105.00 Ų |
XlogP | 3.90 |
CHEBI:185974 |
LMPK12120261 |
(E)-1-[(9R,10S)-5,10-dihydroxy-9-methoxy-2,2,8,8-tetramethyl-9,10-dihydropyrano[2,3-]chromen-6-yl]-3-(4-hydroxyphenyl)prop-2-en-1-one |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.89% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.14% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.99% | 94.45% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.15% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.99% | 86.33% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 90.44% | 89.67% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.20% | 99.17% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.14% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.02% | 95.56% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 84.81% | 85.14% |
CHEMBL2581 | P07339 | Cathepsin D | 84.69% | 98.95% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 83.71% | 95.50% |
CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 83.40% | 90.93% |
CHEMBL3401 | O75469 | Pregnane X receptor | 83.31% | 94.73% |
CHEMBL3194 | P02766 | Transthyretin | 82.94% | 90.71% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 81.00% | 89.62% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.61% | 91.19% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.52% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Lonchocarpus heptaphyllus |
PubChem | 15735847 |
LOTUS | LTS0150991 |
wikiData | Q76506892 |