Dermacozine E
| Internal ID | d2578719-7386-467f-9412-816d024c6b97 |
| Taxonomy | Organoheterocyclic compounds > Diazanaphthalenes > Benzodiazines > Quinoxalines > Phenazines and derivatives |
| IUPAC Name | 12-methyl-1,3-dioxo-4-phenylpyrido[3,4-a]phenazine-8-carboxamide |
| SMILES (Canonical) | CN1C2=CC=CC(=C2N=C3C1=C4C(=C(C(=O)NC4=O)C5=CC=CC=C5)C=C3)C(=O)N |
| SMILES (Isomeric) | CN1C2=CC=CC(=C2N=C3C1=C4C(=C(C(=O)NC4=O)C5=CC=CC=C5)C=C3)C(=O)N |
| InChI | InChI=1S/C23H16N4O3/c1-27-16-9-5-8-14(21(24)28)19(16)25-15-11-10-13-17(12-6-3-2-4-7-12)22(29)26-23(30)18(13)20(15)27/h2-11H,1H3,(H2,24,28)(H,26,29,30) |
| InChI Key | UPYQNHQWWCBCFM-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C23H16N4O3 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.12224039 g/mol |
| Topological Polar Surface Area (TPSA) | 105.00 Ų |
| XlogP | 1.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 98.79% | 98.95% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 97.86% | 99.23% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.99% | 95.56% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.97% | 85.14% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.30% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.38% | 86.33% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 89.50% | 92.29% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 89.03% | 90.17% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 88.99% | 97.00% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 87.08% | 95.50% |
| CHEMBL2083 | P15090 | Fatty acid binding protein adipocyte | 86.80% | 95.71% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.67% | 94.45% |
| CHEMBL1899 | P46098 | Serotonin 3a (5-HT3a) receptor | 86.36% | 100.00% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 85.85% | 94.75% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.76% | 94.00% |
| CHEMBL4924 | Q9UK32 | Ribosomal protein S6 kinase alpha 6 | 85.62% | 80.00% |
| CHEMBL2292 | Q13627 | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | 84.29% | 93.24% |
| CHEMBL3959 | P16083 | Quinone reductase 2 | 84.16% | 89.49% |
| CHEMBL2535 | P11166 | Glucose transporter | 83.99% | 98.75% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.00% | 89.00% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 82.13% | 96.67% |
| CHEMBL5678 | P34947 | G protein-coupled receptor kinase 5 | 82.12% | 88.00% |
| CHEMBL1991 | O14920 | Inhibitor of nuclear factor kappa B kinase beta subunit | 81.64% | 97.15% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 81.00% | 94.42% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.58% | 96.00% |
| CHEMBL5284 | Q96RR4 | CaM-kinase kinase beta | 80.57% | 89.23% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 80.30% | 97.36% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 46223918 |
| LOTUS | LTS0024042 |
| wikiData | Q77492438 |