Demethylvestitol, (R)-
Internal ID | 355fb06b-37bd-40c7-9bfd-7751efbe83a6 |
Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > Isoflavans > Isoflavanols |
IUPAC Name | 4-[(3R)-7-hydroxy-3,4-dihydro-2H-chromen-3-yl]benzene-1,3-diol |
SMILES (Canonical) | C1C(COC2=C1C=CC(=C2)O)C3=C(C=C(C=C3)O)O |
SMILES (Isomeric) | C1[C@@H](COC2=C1C=CC(=C2)O)C3=C(C=C(C=C3)O)O |
InChI | InChI=1S/C15H14O4/c16-11-3-4-13(14(18)6-11)10-5-9-1-2-12(17)7-15(9)19-8-10/h1-4,6-7,10,16-18H,5,8H2/t10-/m0/s1 |
InChI Key | CJZBXHPHEBCWLV-JTQLQIEISA-N |
Popularity | 0 references in papers |
Molecular Formula | C15H14O4 |
Molecular Weight | 258.27 g/mol |
Exact Mass | 258.08920892 g/mol |
Topological Polar Surface Area (TPSA) | 69.90 Ų |
XlogP | 2.60 |
Demethylvestitol, (-)- |
A573928L5Y |
1,3-BENZENEDIOL, 4-(3,4-DIHYDRO-7-HYDROXY-2H-1-BENZOPYRAN-3-YL)-, (R)- |
64190-84-7 |
(R)-demethylvestitol |
UNII-A573928L5Y |
FS-8736 |
Q27273653 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.04% | 91.11% |
CHEMBL236 | P41143 | Delta opioid receptor | 94.89% | 99.35% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 92.79% | 93.40% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.82% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 88.37% | 98.95% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 87.48% | 95.62% |
CHEMBL233 | P35372 | Mu opioid receptor | 86.93% | 97.93% |
CHEMBL2073 | P07947 | Tyrosine-protein kinase YES | 86.56% | 83.14% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.09% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.47% | 95.89% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 84.93% | 93.99% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.45% | 95.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.18% | 94.45% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 83.55% | 91.49% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.20% | 86.33% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.20% | 99.15% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 82.46% | 85.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.40% | 97.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.05% | 89.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.62% | 99.17% |
CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 81.28% | 91.79% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 80.81% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Caragana tibetica |
Erythrina sandwicensis |
Lotus edulis |
Phaseolus coccineus |
Phaseolus vulgaris |
Vigna angularis |
PubChem | 92021067 |
LOTUS | LTS0154398 |
wikiData | Q27273653 |