Dehydrohyperforin
Internal ID | d01f0bc6-77eb-4cdf-944b-221cbe0293ae |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Monoterpenoids |
IUPAC Name | (1R,9S,10R,11S)-4,4,10-trimethyl-1,11-bis(3-methylbut-2-enyl)-10-(4-methylpent-3-enyl)-9-(2-methylpropanoyl)-3-oxatricyclo[7.3.1.02,7]trideca-2(7),5-diene-8,13-dione |
SMILES (Canonical) | CC(C)C(=O)C12C(=O)C3=C(C(C1=O)(CC(C2(C)CCC=C(C)C)CC=C(C)C)CC=C(C)C)OC(C=C3)(C)C |
SMILES (Isomeric) | CC(C)C(=O)[C@]12C(=O)C3=C([C@](C1=O)(C[C@@H]([C@@]2(C)CCC=C(C)C)CC=C(C)C)CC=C(C)C)OC(C=C3)(C)C |
InChI | InChI=1S/C35H50O4/c1-22(2)13-12-18-33(11)26(15-14-23(3)4)21-34(20-16-24(5)6)30-27(17-19-32(9,10)39-30)29(37)35(33,31(34)38)28(36)25(7)8/h13-14,16-17,19,25-26H,12,15,18,20-21H2,1-11H3/t26-,33+,34+,35-/m0/s1 |
InChI Key | FSQFBVMRHUNWAT-ASSHYCDZSA-N |
Popularity | 2 references in papers |
Molecular Formula | C35H50O4 |
Molecular Weight | 534.80 g/mol |
Exact Mass | 534.37091007 g/mol |
Topological Polar Surface Area (TPSA) | 60.40 Ų |
XlogP | 9.00 |
CHEMBL437196 |
DTXSID501098762 |
(6S,7R,8S,10R)-2,6,7,8,9,10-Hexahydro-2,2,7-trimethyl-8,10-bis(3-methyl-2-buten-1-yl)-6-(2-methyl-1-oxopropyl)-7-(4-methyl-3-penten-1-yl)-6,10-methano-5H-cycloocta[b]pyran-5,11-dione |
303115-46-0 |
![2D Structure of Dehydrohyperforin 2D Structure of Dehydrohyperforin](https://plantaedb.com/storage/docs/compounds/2023/11/dehydrohyperforin.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.74% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.64% | 94.45% |
CHEMBL3401 | O75469 | Pregnane X receptor | 95.03% | 94.73% |
CHEMBL2581 | P07339 | Cathepsin D | 94.76% | 98.95% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.79% | 85.14% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.71% | 96.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 90.81% | 97.25% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.45% | 89.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.68% | 97.09% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 84.85% | 83.82% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.66% | 100.00% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 84.32% | 90.17% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 81.13% | 95.71% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 81.08% | 90.08% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.76% | 92.62% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.59% | 95.89% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.31% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Hypericum perforatum |
PubChem | 21590528 |
LOTUS | LTS0179177 |
wikiData | Q105000830 |