Dehydrocurvularin
| Internal ID | 3ff46117-6be9-4b7a-9771-c1d992360984 |
| Taxonomy | Phenylpropanoids and polyketides > Macrolides and analogues |
| IUPAC Name | (5S,9E)-13,15-dihydroxy-5-methyl-4-oxabicyclo[10.4.0]hexadeca-1(12),9,13,15-tetraene-3,11-dione |
| SMILES (Canonical) | CC1CCCC=CC(=O)C2=C(CC(=O)O1)C=C(C=C2O)O |
| SMILES (Isomeric) | C[C@H]1CCC/C=C/C(=O)C2=C(CC(=O)O1)C=C(C=C2O)O |
| InChI | InChI=1S/C16H18O5/c1-10-5-3-2-4-6-13(18)16-11(8-15(20)21-10)7-12(17)9-14(16)19/h4,6-7,9-10,17,19H,2-3,5,8H2,1H3/b6-4+/t10-/m0/s1 |
| InChI Key | AVIRMQMUBGNCKS-RWCYGVJQSA-N |
| Popularity | 46 references in papers |
| Molecular Formula | C16H18O5 |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.11542367 g/mol |
| Topological Polar Surface Area (TPSA) | 83.80 Ų |
| XlogP | 3.00 |
| 21178-57-4 |
| Trans-Dehydrocurvularin |
| PAU7YA7FF9 |
| (5S,9E)-13,15-dihydroxy-5-methyl-4-oxabicyclo[10.4.0]hexadeca-1(12),9,13,15-tetraene-3,11-dione |
| 4,5,6,7-Tetrahydro-11,13-dihydroxy-4-methyl-2H-3-benzoxacyclododecin-2,10-(1H)-dione |
| (5S,9E)-13,15-dihydroxy-5-methyl-4-oxabicyclo(10.4.0)hexadeca-1(12),9,13,15-tetraene-3,11-dione |
| RefChem:919778 |
| (9E)-13,15-dihydroxy-5-methyl-4-oxabicyclo(10.4.0)hexadeca-1(12),9,13,15-tetraene-3,11-dione |
| 10,11-dehydrocurvularin |
| 1095588-70-7 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.35% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.52% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.23% | 98.95% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 90.92% | 90.00% |
| CHEMBL1929 | P47989 | Xanthine dehydrogenase | 90.62% | 96.12% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.02% | 97.09% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.71% | 89.00% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 86.05% | 92.94% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.03% | 94.45% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 83.72% | 96.21% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.95% | 100.00% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 82.27% | 93.40% |
| CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 82.26% | 86.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.16% | 99.23% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.64% | 90.71% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 81.27% | 99.18% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 81.12% | 92.50% |
| CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 80.88% | 85.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.87% | 95.89% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 80.70% | 95.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 6438143 |
| LOTUS | LTS0083657 |
| wikiData | Q15410896 |