Dehydrobruceantarin
Internal ID | 26ecc06d-7f6a-4570-8148-be1e174c4f24 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones > Quassinoids |
IUPAC Name | methyl 3-benzoyloxy-11,15,16-trihydroxy-9,13-dimethyl-4,10-dioxo-5,18-dioxapentacyclo[12.5.0.01,6.02,17.08,13]nonadeca-8,11-diene-17-carboxylate |
SMILES (Canonical) | CC1=C2CC3C45COC(C4C(C(=O)O3)OC(=O)C6=CC=CC=C6)(C(C(C5C2(C=C(C1=O)O)C)O)O)C(=O)OC |
SMILES (Isomeric) | CC1=C2CC3C45COC(C4C(C(=O)O3)OC(=O)C6=CC=CC=C6)(C(C(C5C2(C=C(C1=O)O)C)O)O)C(=O)OC |
InChI | InChI=1S/C28H28O11/c1-12-14-9-16-27-11-37-28(25(35)36-3,22(32)18(31)20(27)26(14,2)10-15(29)17(12)30)21(27)19(24(34)38-16)39-23(33)13-7-5-4-6-8-13/h4-8,10,16,18-22,29,31-32H,9,11H2,1-3H3 |
InChI Key | XFGZLTBOPDPUJU-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C28H28O11 |
Molecular Weight | 540.50 g/mol |
Exact Mass | 540.16316171 g/mol |
Topological Polar Surface Area (TPSA) | 166.00 Ų |
XlogP | 1.70 |
53663-00-6 |
DTXSID80311121 |
NSC238179 |
NSC-238179 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.06% | 91.11% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 95.60% | 90.17% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.50% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 95.28% | 98.95% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 94.01% | 99.23% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 93.30% | 96.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.11% | 86.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.10% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.93% | 85.14% |
CHEMBL5028 | O14672 | ADAM10 | 89.39% | 97.50% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 87.70% | 93.03% |
CHEMBL2535 | P11166 | Glucose transporter | 86.35% | 98.75% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.41% | 95.89% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.84% | 91.19% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.38% | 97.14% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 81.12% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Brucea antidysenterica |
PubChem | 315123 |
LOTUS | LTS0084716 |
wikiData | Q82060538 |