Deglucobalhimycin
| Internal ID | edbde23c-2927-44de-a1cd-96287672edcb |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Oligopeptides |
| IUPAC Name | (1R,2S,18R,19R,22R,25R,28R,40R)-2-[(2R,4R,6R)-4-amino-5,5-dihydroxy-4,6-dimethyloxan-2-yl]oxy-22-(2-amino-2-oxoethyl)-5,15-dichloro-18,32,35,37,48-pentahydroxy-19-[[(2R)-4-methyl-2-(methylamino)pentanoyl]amino]-20,23,26,42,44-pentaoxo-7,13-dioxa-21,24,27,41,43-pentazaoctacyclo[26.14.2.23,6.214,17.18,12.129,33.010,25.034,39]pentaconta-3,5,8,10,12(48),14,16,29(45),30,32,34(39),35,37,46,49-pentadecaene-40-carboxylic acid |
| SMILES (Canonical) | CC1C(C(CC(O1)OC2C3C(=O)NC(C4=C(C(=CC(=C4)O)O)C5=C(C=CC(=C5)C(C(=O)N3)NC(=O)C6C7=CC(=C(C(=C7)OC8=C(C=C2C=C8)Cl)O)OC9=C(C=C(C=C9)C(C(C(=O)NC(C(=O)N6)CC(=O)N)NC(=O)C(CC(C)C)NC)O)Cl)O)C(=O)O)(C)N)(O)O |
| SMILES (Isomeric) | C[C@@H]1C([C@](C[C@@H](O1)O[C@@H]2[C@@H]3C(=O)N[C@H](C4=C(C(=CC(=C4)O)O)C5=C(C=CC(=C5)[C@H](C(=O)N3)NC(=O)[C@H]6C7=CC(=C(C(=C7)OC8=C(C=C2C=C8)Cl)O)OC9=C(C=C(C=C9)[C@H]([C@H](C(=O)N[C@@H](C(=O)N6)CC(=O)N)NC(=O)[C@@H](CC(C)C)NC)O)Cl)O)C(=O)O)(C)N)(O)O |
| InChI | InChI=1S/C60H65Cl2N9O20/c1-22(2)12-33(65-5)52(78)70-47-49(76)25-7-10-37(31(61)14-25)89-39-16-27-17-40(50(39)77)90-38-11-8-26(15-32(38)62)51(91-42-21-59(4,64)60(86,87)23(3)88-42)48-57(83)69-46(58(84)85)30-18-28(72)19-36(74)43(30)29-13-24(6-9-35(29)73)44(54(80)71-48)68-55(81)45(27)67-53(79)34(20-41(63)75)66-56(47)82/h6-11,13-19,22-23,33-34,42,44-49,51,65,72-74,76-77,86-87H,12,20-21,64H2,1-5H3,(H2,63,75)(H,66,82)(H,67,79)(H,68,81)(H,69,83)(H,70,78)(H,71,80)(H,84,85)/t23-,33-,34-,42+,44-,45-,46-,47-,48-,49-,51+,59-/m1/s1 |
| InChI Key | ABWSMPORYONAHZ-MLCXWKRQSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C60H65Cl2N9O20 |
| Molecular Weight | 1303.10 g/mol |
| Exact Mass | 1301.3722909 g/mol |
| Topological Polar Surface Area (TPSA) | 472.00 Ų |
| XlogP | -1.60 |
| Atomic LogP (AlogP) | 1.95 |
| H-Bond Acceptor | 21 |
| H-Bond Donor | 17 |
| Rotatable Bonds | 10 |
| Q27093737 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.8052 | 80.52% |
| Caco-2 | - | 0.8609 | 86.09% |
| Blood Brain Barrier | - | 0.8500 | 85.00% |
| Human oral bioavailability | - | 0.8429 | 84.29% |
| Subcellular localzation | Lysosomes | 0.4362 | 43.62% |
| OATP2B1 inhibitior | - | 0.8616 | 86.16% |
| OATP1B1 inhibitior | + | 0.8622 | 86.22% |
| OATP1B3 inhibitior | + | 0.9394 | 93.94% |
| MATE1 inhibitior | - | 0.9400 | 94.00% |
| OCT2 inhibitior | - | 0.9318 | 93.18% |
| BSEP inhibitior | + | 0.9550 | 95.50% |
| P-glycoprotein inhibitior | + | 0.7423 | 74.23% |
| P-glycoprotein substrate | + | 0.8459 | 84.59% |
| CYP3A4 substrate | + | 0.7567 | 75.67% |
| CYP2C9 substrate | - | 0.8031 | 80.31% |
| CYP2D6 substrate | - | 0.8301 | 83.01% |
| CYP3A4 inhibition | - | 0.8263 | 82.63% |
| CYP2C9 inhibition | - | 0.8697 | 86.97% |
| CYP2C19 inhibition | - | 0.8484 | 84.84% |
| CYP2D6 inhibition | - | 0.9107 | 91.07% |
| CYP1A2 inhibition | - | 0.8243 | 82.43% |
| CYP2C8 inhibition | + | 0.8453 | 84.53% |
| CYP inhibitory promiscuity | - | 0.7706 | 77.06% |
| UGT catelyzed | + | 0.7000 | 70.00% |
| Carcinogenicity (binary) | - | 0.7800 | 78.00% |
| Carcinogenicity (trinary) | Non-required | 0.4658 | 46.58% |
| Eye corrosion | - | 0.9849 | 98.49% |
| Eye irritation | - | 0.8969 | 89.69% |
| Skin irritation | - | 0.7795 | 77.95% |
| Skin corrosion | - | 0.9269 | 92.69% |
| Ames mutagenesis | - | 0.5200 | 52.00% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.7132 | 71.32% |
| Micronuclear | + | 0.8000 | 80.00% |
| Hepatotoxicity | + | 0.5750 | 57.50% |
| skin sensitisation | - | 0.8489 | 84.89% |
| Respiratory toxicity | + | 0.9111 | 91.11% |
| Reproductive toxicity | + | 0.9000 | 90.00% |
| Mitochondrial toxicity | + | 0.8125 | 81.25% |
| Nephrotoxicity | + | 0.5659 | 56.59% |
| Acute Oral Toxicity (c) | III | 0.5995 | 59.95% |
| Estrogen receptor binding | + | 0.6985 | 69.85% |
| Androgen receptor binding | + | 0.7772 | 77.72% |
| Thyroid receptor binding | + | 0.7067 | 70.67% |
| Glucocorticoid receptor binding | + | 0.7457 | 74.57% |
| Aromatase binding | + | 0.6862 | 68.62% |
| PPAR gamma | + | 0.7959 | 79.59% |
| Honey bee toxicity | - | 0.6468 | 64.68% |
| Biodegradation | - | 0.8750 | 87.50% |
| Crustacea aquatic toxicity | - | 0.5755 | 57.55% |
| Fish aquatic toxicity | + | 0.9000 | 90.00% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.83% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 99.73% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 99.21% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.84% | 96.09% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 97.82% | 99.15% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 96.85% | 90.00% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 96.65% | 96.21% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.91% | 97.09% |
| CHEMBL3837 | P07711 | Cathepsin L | 94.04% | 96.61% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 93.50% | 96.38% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 92.96% | 85.11% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.77% | 86.33% |
| CHEMBL236 | P41143 | Delta opioid receptor | 92.75% | 99.35% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 92.45% | 95.89% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 91.76% | 89.50% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.71% | 95.56% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.48% | 89.00% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 91.05% | 100.00% |
| CHEMBL2083 | P15090 | Fatty acid binding protein adipocyte | 90.75% | 95.71% |
| CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 90.75% | 92.32% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 90.59% | 90.17% |
| CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 89.42% | 85.31% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 88.17% | 97.14% |
| CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 88.01% | 85.00% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 87.93% | 96.11% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 87.57% | 91.19% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 87.46% | 96.47% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 86.76% | 93.56% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 86.68% | 95.71% |
| CHEMBL2243 | O00519 | Anandamide amidohydrolase | 85.98% | 97.53% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 85.33% | 98.35% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 85.23% | 95.38% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 84.81% | 95.78% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.54% | 99.17% |
| CHEMBL4630 | O14757 | Serine/threonine-protein kinase Chk1 | 84.39% | 97.03% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 84.38% | 89.62% |
| CHEMBL222 | P23975 | Norepinephrine transporter | 83.94% | 96.06% |
| CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 83.19% | 96.25% |
| CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 82.35% | 97.31% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 81.94% | 96.90% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 81.91% | 90.24% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.69% | 90.71% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 81.53% | 91.49% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 81.11% | 92.29% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 81.07% | 93.10% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.23% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 46936491 |
| LOTUS | LTS0186888 |
| wikiData | Q27093737 |