Decahydro-4,8,8-trimethyl-1,4-methanoazulene-9-carboxaldehyde
| Internal ID | ff791944-19e0-43d4-a6d7-3b90bcc5d151 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
| IUPAC Name | 3,3,7-trimethyltricyclo[5.4.0.02,9]undecane-8-carbaldehyde |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C15H24O/c1-14(2)7-4-8-15(3)11-6-5-10(13(11)14)12(15)9-16/h9-13H,4-8H2,1-3H3 |
| InChI Key | PBMHTGOFWRRJFS-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.35 g/mol |
| Exact Mass | 220.182715385 g/mol |
| Topological Polar Surface Area (TPSA) | 17.10 Ų |
| XlogP | 4.30 |
| 79645-28-6 |
| DTXSID801182423 |
| Decahydro-4,8,8-trimethyl-1,4-methanoazulene-9-carboxaldehyde |
| 3,3,7-trimethyltricyclo(5.4.0.02,9)undecane-8-carbaldehyde |
| 3,3,7-trimethyltricyclo[5.4.0.02,9]undecane-8-carbaldehyde |
| RefChem:1083006 |
| DTXCID601463463 |
| 279-209-6 |
| Longifolenaldehyde |
| EINECS 279-209-6 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4370 | P16662 | UDP-glucuronosyltransferase 2B7 | 98.51% | 100.00% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 92.19% | 99.18% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.02% | 97.25% |
| CHEMBL233 | P35372 | Mu opioid receptor | 90.53% | 97.93% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.29% | 96.09% |
| CHEMBL1871 | P10275 | Androgen Receptor | 88.96% | 96.43% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.43% | 100.00% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 86.75% | 93.04% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 85.26% | 82.69% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.51% | 95.56% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 83.61% | 92.50% |
| CHEMBL1907601 | P11802 | Cyclin-dependent kinase 4/cyclin D1 | 82.57% | 98.99% |
| CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 82.00% | 94.78% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.97% | 97.09% |
| CHEMBL2664 | P23526 | Adenosylhomocysteinase | 81.46% | 86.67% |
| CHEMBL3012 | Q13946 | Phosphodiesterase 7A | 81.11% | 99.29% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 80.71% | 92.88% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 80.56% | 96.77% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 80.43% | 98.10% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 80.41% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Artemisia annua |
| Artemisia carvifolia |
| Chrysanthemum indicum |
| Dolomiaea souliei |
| PubChem | 565584 |
| NPASS | NPC136534 |
| LOTUS | LTS0096085 |
| wikiData | Q67880180 |