Dec-2-en-4,6,8-triynedioic acid
| Internal ID | a3fe4248-855e-4d53-a344-e60eee7d25c5 |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty acids and conjugates > Medium-chain fatty acids |
| IUPAC Name | dec-2-en-4,6,8-triynedioic acid |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C10H4O4/c11-9(12)7-5-3-1-2-4-6-8-10(13)14/h5,7H,(H,11,12)(H,13,14) |
| InChI Key | QWDVMCKBEOAATM-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C10H4O4 |
| Molecular Weight | 188.14 g/mol |
| Exact Mass | 188.01095860 g/mol |
| Topological Polar Surface Area (TPSA) | 74.60 Ų |
| XlogP | 1.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162890869 |
| LOTUS | LTS0136501 |
| wikiData | Q104196275 |