Deapio platycodin D
Internal ID | cbc2c760-340e-414d-a68d-abe16bb70533 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Triterpene glycosides > Triterpene saponins |
IUPAC Name | [3-[3,4-dihydroxy-6-methyl-5-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-2-yl]oxy-4,5-dihydroxyoxan-2-yl] 10-[3,5-dihydroxy-6-(hydroxymethyl)-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-5,11-dihydroxy-9,9-bis(hydroxymethyl)-2,2,6a,6b,12a-pentamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(C(COC2OC(=O)C34CCC(CC3C5=CCC6C(C5(CC4O)C)(CCC7C6(CC(C(C7(CO)CO)OC8C(C(C(C(O8)CO)O)OC9C(C(C(C(O9)CO)O)O)O)O)O)C)C)(C)C)O)O)O)O)OC1C(C(C(CO1)O)O)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)OC2C(C(COC2OC(=O)C34CCC(CC3C5=CCC6C(C5(CC4O)C)(CCC7C6(CC(C(C7(CO)CO)OC8C(C(C(C(O8)CO)O)OC9C(C(C(C(O9)CO)O)O)O)O)O)C)C)(C)C)O)O)O)O)OC1C(C(C(CO1)O)O)O |
InChI | InChI=1S/C58H94O29/c1-22-43(83-47-39(73)33(67)26(64)18-78-47)38(72)41(75)48(80-22)85-45-34(68)27(65)19-79-51(45)87-52(77)58-12-11-53(2,3)13-24(58)23-7-8-30-54(4)14-25(63)46(57(20-61,21-62)31(54)9-10-55(30,5)56(23,6)15-32(58)66)86-50-42(76)44(36(70)29(17-60)82-50)84-49-40(74)37(71)35(69)28(16-59)81-49/h7,22,24-51,59-76H,8-21H2,1-6H3 |
InChI Key | WHADRFMYRLBVAJ-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C58H94O29 |
Molecular Weight | 1255.30 g/mol |
Exact Mass | 1254.58807696 g/mol |
Topological Polar Surface Area (TPSA) | 474.00 Ų |
XlogP | -4.10 |
Platycoside A |
209404-00-2 |
AKOS040764274 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.15% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.32% | 96.09% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 94.85% | 97.36% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.71% | 97.25% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.02% | 94.45% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.50% | 86.33% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 92.27% | 96.77% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 91.43% | 96.61% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.42% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.09% | 95.56% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.08% | 100.00% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 86.82% | 96.21% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 86.11% | 94.75% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 85.61% | 95.50% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.39% | 94.00% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 84.03% | 86.92% |
CHEMBL2581 | P07339 | Cathepsin D | 84.01% | 98.95% |
CHEMBL5028 | O14672 | ADAM10 | 83.93% | 97.50% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.54% | 91.19% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 82.33% | 91.07% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.93% | 94.33% |
CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR | 81.57% | 92.78% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 80.83% | 95.93% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 80.70% | 91.24% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.41% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Platycodon grandiflorus |
PubChem | 75251596 |
LOTUS | LTS0015397 |
wikiData | Q105305180 |