deamino-hLeu-DL-Val-DL-xiThr(1)-DL-Leu-DL-Pro-DL-Val-DL-Val-DL-Val-(1)
| Internal ID | 8e1751c3-1f01-4687-89b8-85245231f89a |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Depsipeptides > Cyclic depsipeptides |
| IUPAC Name | 5-methyl-N-[3-methyl-1-[[7-methyl-3-(2-methylpropyl)-2,5,9,12,15,18-hexaoxo-10,13,16-tri(propan-2-yl)-8-oxa-1,4,11,14,17-pentazabicyclo[17.3.0]docosan-6-yl]amino]-1-oxobutan-2-yl]hexanamide |
| SMILES (Canonical) | CC1C(C(=O)NC(C(=O)N2CCCC2C(=O)NC(C(=O)NC(C(=O)NC(C(=O)O1)C(C)C)C(C)C)C(C)C)CC(C)C)NC(=O)C(C(C)C)NC(=O)CCCC(C)C |
| SMILES (Isomeric) | CC1C(C(=O)NC(C(=O)N2CCCC2C(=O)NC(C(=O)NC(C(=O)NC(C(=O)O1)C(C)C)C(C)C)C(C)C)CC(C)C)NC(=O)C(C(C)C)NC(=O)CCCC(C)C |
| InChI | InChI=1S/C42H73N7O9/c1-21(2)16-14-18-30(50)44-31(23(5)6)37(52)48-35-27(13)58-42(57)34(26(11)12)47-39(54)33(25(9)10)46-38(53)32(24(7)8)45-36(51)29-17-15-19-49(29)41(56)28(20-22(3)4)43-40(35)55/h21-29,31-35H,14-20H2,1-13H3,(H,43,55)(H,44,50)(H,45,51)(H,46,53)(H,47,54)(H,48,52) |
| InChI Key | UPFLQMGRZPVKQS-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C42H73N7O9 |
| Molecular Weight | 820.10 g/mol |
| Exact Mass | 819.54697693 g/mol |
| Topological Polar Surface Area (TPSA) | 221.00 Ų |
| XlogP | 5.80 |
| Atomic LogP (AlogP) | 2.33 |
| H-Bond Acceptor | 9 |
| H-Bond Donor | 6 |
| Rotatable Bonds | 13 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | - | 0.5000 | 50.00% |
| Caco-2 | - | 0.8532 | 85.32% |
| Blood Brain Barrier | - | 0.8000 | 80.00% |
| Human oral bioavailability | - | 0.6286 | 62.86% |
| Subcellular localzation | Lysosomes | 0.5287 | 52.87% |
| OATP2B1 inhibitior | + | 0.5682 | 56.82% |
| OATP1B1 inhibitior | + | 0.8595 | 85.95% |
| OATP1B3 inhibitior | + | 0.9061 | 90.61% |
| MATE1 inhibitior | - | 0.9800 | 98.00% |
| OCT2 inhibitior | - | 0.9000 | 90.00% |
| BSEP inhibitior | + | 0.6119 | 61.19% |
| P-glycoprotein inhibitior | + | 0.7333 | 73.33% |
| P-glycoprotein substrate | + | 0.8812 | 88.12% |
| CYP3A4 substrate | + | 0.6758 | 67.58% |
| CYP2C9 substrate | + | 0.5853 | 58.53% |
| CYP2D6 substrate | - | 0.8438 | 84.38% |
| CYP3A4 inhibition | - | 0.9336 | 93.36% |
| CYP2C9 inhibition | - | 0.9345 | 93.45% |
| CYP2C19 inhibition | - | 0.9149 | 91.49% |
| CYP2D6 inhibition | - | 0.9348 | 93.48% |
| CYP1A2 inhibition | - | 0.9560 | 95.60% |
| CYP2C8 inhibition | - | 0.6386 | 63.86% |
| CYP inhibitory promiscuity | - | 0.9822 | 98.22% |
| UGT catelyzed | - | 0.0000 | 0.00% |
| Carcinogenicity (binary) | - | 0.9500 | 95.00% |
| Carcinogenicity (trinary) | Non-required | 0.6135 | 61.35% |
| Eye corrosion | - | 0.9882 | 98.82% |
| Eye irritation | - | 0.9041 | 90.41% |
| Skin irritation | - | 0.7921 | 79.21% |
| Skin corrosion | - | 0.9195 | 91.95% |
| Ames mutagenesis | - | 0.7100 | 71.00% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.5134 | 51.34% |
| Micronuclear | + | 0.7800 | 78.00% |
| Hepatotoxicity | + | 0.6250 | 62.50% |
| skin sensitisation | - | 0.8863 | 88.63% |
| Respiratory toxicity | + | 0.7778 | 77.78% |
| Reproductive toxicity | + | 0.8222 | 82.22% |
| Mitochondrial toxicity | + | 0.8500 | 85.00% |
| Nephrotoxicity | + | 0.6011 | 60.11% |
| Acute Oral Toxicity (c) | III | 0.6677 | 66.77% |
| Estrogen receptor binding | + | 0.7808 | 78.08% |
| Androgen receptor binding | + | 0.5670 | 56.70% |
| Thyroid receptor binding | + | 0.5390 | 53.90% |
| Glucocorticoid receptor binding | + | 0.6757 | 67.57% |
| Aromatase binding | + | 0.6893 | 68.93% |
| PPAR gamma | + | 0.6921 | 69.21% |
| Honey bee toxicity | - | 0.8296 | 82.96% |
| Biodegradation | - | 0.7250 | 72.50% |
| Crustacea aquatic toxicity | + | 0.5900 | 59.00% |
| Fish aquatic toxicity | + | 0.8380 | 83.80% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.68% | 98.95% |
| CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 99.23% | 96.31% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 97.36% | 90.08% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 97.08% | 94.66% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.26% | 85.14% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 95.25% | 92.97% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 94.21% | 98.05% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.83% | 96.09% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 93.26% | 90.71% |
| CHEMBL283 | P08254 | Matrix metalloproteinase 3 | 92.81% | 97.29% |
| CHEMBL332 | P03956 | Matrix metalloproteinase-1 | 92.05% | 94.50% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 91.60% | 96.11% |
| CHEMBL3837 | P07711 | Cathepsin L | 91.19% | 96.61% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 91.16% | 82.38% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 91.15% | 93.56% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.95% | 97.09% |
| CHEMBL321 | P14780 | Matrix metalloproteinase 9 | 90.95% | 92.12% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.85% | 91.11% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 90.73% | 97.25% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.36% | 99.17% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 90.13% | 96.47% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 89.14% | 98.33% |
| CHEMBL4072 | P07858 | Cathepsin B | 88.73% | 93.67% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 88.14% | 93.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.55% | 99.23% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 87.26% | 95.00% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 87.20% | 89.50% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 87.17% | 96.38% |
| CHEMBL3468 | P55210 | Caspase-7 | 86.20% | 95.68% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 86.18% | 96.90% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.77% | 95.56% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 83.90% | 97.14% |
| CHEMBL1075317 | P61964 | WD repeat-containing protein 5 | 83.81% | 96.33% |
| CHEMBL3691 | Q13822 | Autotaxin | 83.43% | 96.39% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 83.39% | 100.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.32% | 94.45% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 83.24% | 93.03% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 82.29% | 95.50% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 81.80% | 97.64% |
| CHEMBL4073 | P09237 | Matrix metalloproteinase 7 | 81.72% | 97.56% |
| CHEMBL1902 | P62942 | FK506-binding protein 1A | 81.70% | 97.05% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.60% | 95.89% |
| CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 81.57% | 85.00% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 81.52% | 98.59% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 81.22% | 95.62% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 80.83% | 88.56% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.49% | 94.33% |
| CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 80.08% | 97.86% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 78136598 |
| LOTUS | LTS0137340 |
| wikiData | Q104198577 |