4H-1-benzopyran-4-one, 7-[[(2E)-3,7-dimethyl-2,6-octadienyl]oxy]-2,3-dihydro-5-hydroxy-2-(4-hydroxyphenyl)-, (2S)-
Internal ID | a9ea6c3c-e907-47e8-81f1-69c88c916a90 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavans > Flavanones |
IUPAC Name | (2S)-7-[(2E)-3,7-dimethylocta-2,6-dienoxy]-5-hydroxy-2-(4-hydroxyphenyl)-2,3-dihydrochromen-4-one |
SMILES (Canonical) | CC(=CCCC(=CCOC1=CC(=C2C(=O)CC(OC2=C1)C3=CC=C(C=C3)O)O)C)C |
SMILES (Isomeric) | CC(=CCC/C(=C/COC1=CC(=C2C(=O)C[C@H](OC2=C1)C3=CC=C(C=C3)O)O)/C)C |
InChI | InChI=1S/C25H28O5/c1-16(2)5-4-6-17(3)11-12-29-20-13-21(27)25-22(28)15-23(30-24(25)14-20)18-7-9-19(26)10-8-18/h5,7-11,13-14,23,26-27H,4,6,12,15H2,1-3H3/b17-11+/t23-/m0/s1 |
InChI Key | WTJXQLRTGAFRSC-HZUJZGFBSA-N |
Popularity | 2 references in papers |
Molecular Formula | C25H28O5 |
Molecular Weight | 408.50 g/mol |
Exact Mass | 408.19367399 g/mol |
Topological Polar Surface Area (TPSA) | 76.00 Ų |
XlogP | 6.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.00% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.52% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 95.20% | 98.95% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.58% | 99.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.44% | 96.09% |
CHEMBL3401 | O75469 | Pregnane X receptor | 93.21% | 94.73% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.90% | 97.09% |
CHEMBL4208 | P20618 | Proteasome component C5 | 91.84% | 90.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.94% | 89.00% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 89.84% | 93.10% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.35% | 95.56% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 88.99% | 99.15% |
CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 88.79% | 92.68% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.51% | 86.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.67% | 95.89% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.19% | 99.23% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 82.37% | 92.08% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 81.16% | 95.71% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.01% | 90.71% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 80.93% | 94.80% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.92% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Tephrosia villosa |
PubChem | 5716904 |
LOTUS | LTS0046237 |
wikiData | Q105312600 |