7-[(5,5,8a-Trimethyl-2-methylidene-6-oxo-1,3,4,4a-tetrahydronaphthalen-1-yl)methoxy]-6,8-dimethoxychromen-2-one
| Internal ID | 479ac3b1-3857-4abc-896b-b003d3352bfa |
| Taxonomy | Phenylpropanoids and polyketides > Coumarins and derivatives |
| IUPAC Name | 7-[(5,5,8a-trimethyl-2-methylidene-6-oxo-1,3,4,4a-tetrahydronaphthalen-1-yl)methoxy]-6,8-dimethoxychromen-2-one |
| SMILES (Canonical) | CC1(C2CCC(=C)C(C2(C=CC1=O)C)COC3=C(C=C4C=CC(=O)OC4=C3OC)OC)C |
| SMILES (Isomeric) | CC1(C2CCC(=C)C(C2(C=CC1=O)C)COC3=C(C=C4C=CC(=O)OC4=C3OC)OC)C |
| InChI | InChI=1S/C26H30O6/c1-15-7-9-19-25(2,3)20(27)11-12-26(19,4)17(15)14-31-23-18(29-5)13-16-8-10-21(28)32-22(16)24(23)30-6/h8,10-13,17,19H,1,7,9,14H2,2-6H3 |
| InChI Key | ARABNLIVSPLIGZ-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C26H30O6 |
| Molecular Weight | 438.50 g/mol |
| Exact Mass | 438.20423867 g/mol |
| Topological Polar Surface Area (TPSA) | 71.10 Ų |
| XlogP | 4.80 |
| There are no found synonyms. |
![2D Structure of 7-[(5,5,8a-Trimethyl-2-methylidene-6-oxo-1,3,4,4a-tetrahydronaphthalen-1-yl)methoxy]-6,8-dimethoxychromen-2-one](https://plantaedb.com/storage/docs/compounds/2023/11/de3682b0-8737-11ee-96b4-5b0eac59c6d8.jpg "2D Structure of 7-[(5,5,8a-Trimethyl-2-methylidene-6-oxo-1,3,4,4a-tetrahydronaphthalen-1-yl)methoxy]-6,8-dimethoxychromen-2-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.33% | 91.11% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.93% | 94.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.35% | 94.45% |
| CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 90.14% | 94.03% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 89.16% | 92.62% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.63% | 97.09% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 87.88% | 94.75% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 87.78% | 93.99% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 87.40% | 95.83% |
| CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 87.27% | 85.49% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.64% | 95.56% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.15% | 99.17% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.11% | 99.23% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.51% | 86.33% |
| CHEMBL5925 | P22413 | Ectonucleotide pyrophosphatase/phosphodiesterase family member 1 | 82.90% | 92.38% |
| CHEMBL2535 | P11166 | Glucose transporter | 82.77% | 98.75% |
| CHEMBL261 | P00915 | Carbonic anhydrase I | 82.63% | 96.76% |
| CHEMBL2581 | P07339 | Cathepsin D | 82.24% | 98.95% |
| CHEMBL1871 | P10275 | Androgen Receptor | 80.60% | 96.43% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Anthemis cretica |
| PubChem | 162956912 |
| LOTUS | LTS0097345 |
| wikiData | Q104917193 |