[(2S,3R,4R,5S,6S)-5-[(2S,3R,4S,5R,6S)-3,4-dihydroxy-6-methyl-5-[(2S)-2-methylbutanoyl]oxyoxan-2-yl]oxy-6-methyl-2-[[(1R,3S,5S,6R,7R,8R,20S,22R,24R,25R,26S)-7,25,26-trihydroxy-5,24-dimethyl-10-oxo-20-pentyl-2,4,9,21,23-pentaoxatricyclo[20.4.0.03,8]hexacosan-6-yl]oxy]-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-3-yl] dodecanoate
Internal ID | a5ccf8d6-2687-487d-a1c6-3a03d572cef1 |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Oligosaccharides |
IUPAC Name | [(2S,3R,4R,5S,6S)-5-[(2S,3R,4S,5R,6S)-3,4-dihydroxy-6-methyl-5-[(2S)-2-methylbutanoyl]oxyoxan-2-yl]oxy-6-methyl-2-[[(1R,3S,5S,6R,7R,8R,20S,22R,24R,25R,26S)-7,25,26-trihydroxy-5,24-dimethyl-10-oxo-20-pentyl-2,4,9,21,23-pentaoxatricyclo[20.4.0.03,8]hexacosan-6-yl]oxy]-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-3-yl] dodecanoate |
SMILES (Canonical) | CCCCCCCCCCCC(=O)OC1C(C(C(OC1OC2C(OC3C(C2O)OC(=O)CCCCCCCCCC(OC4C(O3)C(C(C(O4)C)O)O)CCCCC)C)C)OC5C(C(C(C(O5)C)OC(=O)C(C)CC)O)O)OC6C(C(C(C(O6)CO)O)O)O |
SMILES (Isomeric) | CCCCCCCCCCCC(=O)O[C@@H]1[C@@H]([C@H]([C@@H](O[C@H]1O[C@H]2[C@@H](O[C@@H]3[C@@H]([C@@H]2O)OC(=O)CCCCCCCCC[C@@H](O[C@H]4[C@H](O3)[C@H]([C@H]([C@H](O4)C)O)O)CCCCC)C)C)O[C@H]5[C@@H]([C@@H]([C@H]([C@@H](O5)C)OC(=O)[C@@H](C)CC)O)O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O |
InChI | InChI=1S/C63H110O25/c1-9-12-14-15-16-17-20-23-28-32-42(66)83-57-56(88-60-48(72)45(69)44(68)40(33-64)81-60)53(86-59-49(73)47(71)51(36(6)77-59)84-58(75)34(4)11-3)38(8)79-63(57)85-52-37(7)78-62-55(50(52)74)82-41(65)31-27-24-21-18-19-22-26-30-39(29-25-13-10-2)80-61-54(87-62)46(70)43(67)35(5)76-61/h34-40,43-57,59-64,67-74H,9-33H2,1-8H3/t34-,35+,36-,37-,38-,39-,40+,43-,44+,45-,46-,47-,48+,49+,50+,51-,52-,53-,54+,55+,56+,57+,59-,60-,61-,62-,63-/m0/s1 |
InChI Key | CBUHKOQGPBOLBI-VJOUTXDUSA-N |
Popularity | 0 references in papers |
Molecular Formula | C63H110O25 |
Molecular Weight | 1267.50 g/mol |
Exact Mass | 1266.73361899 g/mol |
Topological Polar Surface Area (TPSA) | 353.00 Ų |
XlogP | 7.70 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 99.30% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.01% | 96.09% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 96.87% | 92.50% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.46% | 91.11% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 94.87% | 100.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.76% | 99.17% |
CHEMBL220 | P22303 | Acetylcholinesterase | 94.65% | 94.45% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 94.04% | 93.56% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 93.32% | 97.79% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.16% | 97.25% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 92.51% | 96.61% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 90.28% | 96.47% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.13% | 89.00% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 89.64% | 97.36% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.11% | 97.09% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 88.65% | 95.50% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 88.33% | 92.62% |
CHEMBL4072 | P07858 | Cathepsin B | 87.79% | 93.67% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.56% | 95.89% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.42% | 90.71% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 86.42% | 97.29% |
CHEMBL237 | P41145 | Kappa opioid receptor | 86.01% | 98.10% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 85.71% | 92.86% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 85.04% | 100.00% |
CHEMBL4462 | Q8IXJ6 | NAD-dependent deacetylase sirtuin 2 | 84.83% | 90.24% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.65% | 91.19% |
CHEMBL299 | P17252 | Protein kinase C alpha | 84.65% | 98.03% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 84.21% | 82.50% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.13% | 86.33% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 83.88% | 96.21% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.66% | 95.56% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 83.65% | 90.08% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 83.06% | 94.33% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.03% | 96.00% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 82.85% | 83.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.93% | 99.23% |
CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 81.61% | 96.37% |
CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 81.49% | 92.32% |
CHEMBL3524 | P56524 | Histone deacetylase 4 | 81.30% | 92.97% |
CHEMBL2514 | O95665 | Neurotensin receptor 2 | 81.20% | 100.00% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 80.35% | 96.38% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ipomoea quamoclit |
PubChem | 10374193 |
LOTUS | LTS0124467 |
wikiData | Q104170049 |