[6-[[3,4-Dihydroxy-6-(hydroxymethyl)-5-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl] 2,2,6a,6b,9,9,12a-heptamethyl-3,10-dioxo-1,4,5,6,7,8,8a,11,12,14b-decahydropicene-4a-carboxylate
Internal ID | 37ab3a8f-96e7-42c0-80ab-922c1c5b2104 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | [6-[[3,4-dihydroxy-6-(hydroxymethyl)-5-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl] 2,2,6a,6b,9,9,12a-heptamethyl-3,10-dioxo-1,4,5,6,7,8,8a,11,12,14b-decahydropicene-4a-carboxylate |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(OC(C(C2O)O)OCC3C(C(C(C(O3)OC(=O)C45CCC6(C(=CC=C7C6(CCC8C7(CCC(=O)C8(C)C)C)C)C4CC(C(=O)C5)(C)C)C)O)O)O)CO)O)O)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)OC2C(OC(C(C2O)O)OCC3C(C(C(C(O3)OC(=O)C45CCC6(C(=CC=C7C6(CCC8C7(CCC(=O)C8(C)C)C)C)C4CC(C(=O)C5)(C)C)C)O)O)O)CO)O)O)O |
InChI | InChI=1S/C48H72O18/c1-21-30(52)32(54)35(57)40(62-21)65-38-24(19-49)63-39(37(59)34(38)56)61-20-25-31(53)33(55)36(58)41(64-25)66-42(60)48-16-15-46(7)22(23(48)17-43(2,3)29(51)18-48)9-10-27-45(6)13-12-28(50)44(4,5)26(45)11-14-47(27,46)8/h9-10,21,23-26,30-41,49,52-59H,11-20H2,1-8H3 |
InChI Key | HQHPGJDVUZNSTL-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C48H72O18 |
Molecular Weight | 937.10 g/mol |
Exact Mass | 936.47186544 g/mol |
Topological Polar Surface Area (TPSA) | 289.00 Ų |
XlogP | -0.40 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.94% | 91.11% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 96.98% | 95.93% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.05% | 97.09% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.88% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 90.36% | 98.95% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 90.11% | 97.36% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.43% | 86.33% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 87.76% | 95.83% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.39% | 94.00% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 87.23% | 92.50% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 87.00% | 97.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.67% | 89.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.73% | 100.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.54% | 99.23% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.21% | 94.45% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 83.63% | 93.04% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 82.67% | 91.71% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.31% | 95.56% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 80.96% | 97.25% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 80.32% | 91.24% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Tetrapanax papyrifer |
PubChem | 85254945 |
LOTUS | LTS0274773 |
wikiData | Q105032244 |