(1S,2R,7R,9S)-6-acetyl-1'-methyl-2'-oxospiro[4-oxa-12-azatricyclo[7.2.1.02,7]dodec-5-ene-10,3'-indole]-12-carbaldehyde
Internal ID | 760fdb54-5f6d-4b43-950c-8b1ec9d26d6f |
Taxonomy | Organoheterocyclic compounds > Indoles and derivatives |
IUPAC Name | (1S,2R,7R,9S)-6-acetyl-1'-methyl-2'-oxospiro[4-oxa-12-azatricyclo[7.2.1.02,7]dodec-5-ene-10,3'-indole]-12-carbaldehyde |
SMILES (Canonical) | CC(=O)C1=COCC2C1CC3C4(CC2N3C=O)C5=CC=CC=C5N(C4=O)C |
SMILES (Isomeric) | CC(=O)C1=COC[C@@H]2[C@H]1C[C@H]3C4(C[C@@H]2N3C=O)C5=CC=CC=C5N(C4=O)C |
InChI | InChI=1S/C21H22N2O4/c1-12(25)14-9-27-10-15-13(14)7-19-21(8-18(15)23(19)11-24)16-5-3-4-6-17(16)22(2)20(21)26/h3-6,9,11,13,15,18-19H,7-8,10H2,1-2H3/t13-,15+,18-,19-,21?/m0/s1 |
InChI Key | SANFAUSBJXJGKX-HZGCYMHYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H22N2O4 |
Molecular Weight | 366.40 g/mol |
Exact Mass | 366.15795719 g/mol |
Topological Polar Surface Area (TPSA) | 66.90 Ų |
XlogP | 0.70 |
There are no found synonyms. |
![2D Structure of (1S,2R,7R,9S)-6-acetyl-1'-methyl-2'-oxospiro[4-oxa-12-azatricyclo[7.2.1.02,7]dodec-5-ene-10,3'-indole]-12-carbaldehyde 2D Structure of (1S,2R,7R,9S)-6-acetyl-1'-methyl-2'-oxospiro[4-oxa-12-azatricyclo[7.2.1.02,7]dodec-5-ene-10,3'-indole]-12-carbaldehyde](https://plantaedb.com/storage/docs/compounds/2023/11/ddefd320-8679-11ee-b322-477e80d14c51.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.27% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.95% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.07% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 91.15% | 98.95% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.10% | 85.14% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.61% | 86.33% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.21% | 91.19% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.65% | 90.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.29% | 89.00% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 83.03% | 95.50% |
CHEMBL5028 | O14672 | ADAM10 | 82.56% | 97.50% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.20% | 94.45% |
CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 80.70% | 85.11% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 80.46% | 90.24% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 80.04% | 82.69% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Alstonia angustifolia |
PubChem | 163188321 |
LOTUS | LTS0152742 |
wikiData | Q105248975 |