2-(4,4,7,8a-tetramethylspiro[2,3,4a,5,6,7-hexahydro-1H-naphthalene-8,5'-oxolane]-2'-ylidene)acetaldehyde
| Internal ID | 76ad5ae8-f435-4e04-b129-91471bb4034a |
| Taxonomy | Organoheterocyclic compounds > Oxolanes |
| IUPAC Name | 2-(4,4,7,8a-tetramethylspiro[2,3,4a,5,6,7-hexahydro-1H-naphthalene-8,5'-oxolane]-2'-ylidene)acetaldehyde |
| SMILES (Canonical) | CC1CCC2C(CCCC2(C13CCC(=CC=O)O3)C)(C)C |
| SMILES (Isomeric) | CC1CCC2C(CCCC2(C13CCC(=CC=O)O3)C)(C)C |
| InChI | InChI=1S/C19H30O2/c1-14-6-7-16-17(2,3)10-5-11-18(16,4)19(14)12-8-15(21-19)9-13-20/h9,13-14,16H,5-8,10-12H2,1-4H3 |
| InChI Key | NUOORXQOTIGTCT-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.224580195 g/mol |
| Topological Polar Surface Area (TPSA) | 26.30 Ų |
| XlogP | 5.00 |
| There are no found synonyms. |
![2D Structure of 2-(4,4,7,8a-tetramethylspiro[2,3,4a,5,6,7-hexahydro-1H-naphthalene-8,5'-oxolane]-2'-ylidene)acetaldehyde](https://plantaedb.com/storage/docs/compounds/2023/11/ddd7ea60-85f0-11ee-a024-53fafb9115f7.jpg "2D Structure of 2-(4,4,7,8a-tetramethylspiro[2,3,4a,5,6,7-hexahydro-1H-naphthalene-8,5'-oxolane]-2'-ylidene)acetaldehyde")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.12% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.94% | 95.56% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 90.04% | 91.49% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 88.33% | 97.25% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.95% | 100.00% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 85.73% | 92.94% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 85.62% | 93.40% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 85.45% | 96.38% |
| CHEMBL2581 | P07339 | Cathepsin D | 85.37% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.29% | 96.09% |
| CHEMBL3012 | Q13946 | Phosphodiesterase 7A | 85.20% | 99.29% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.29% | 97.09% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.58% | 95.89% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 82.35% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Vitex trifolia |
| PubChem | 72751474 |
| LOTUS | LTS0085068 |
| wikiData | Q105185962 |