[3-[5-[5-[5-(3,5-Dihydroxy-4-methoxy-6-methyloxan-2-yl)oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-8,14,17-trihydroxy-17-(1-hydroxyethyl)-10,13-dimethyl-1,2,3,4,7,9,11,12,15,16-decahydrocyclopenta[a]phenanthren-12-yl] 3-phenylprop-2-enoate
Internal ID | 26596f22-3b5e-4940-a5fb-a607e6636b0f |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides |
IUPAC Name | [3-[5-[5-[5-(3,5-dihydroxy-4-methoxy-6-methyloxan-2-yl)oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-8,14,17-trihydroxy-17-(1-hydroxyethyl)-10,13-dimethyl-1,2,3,4,7,9,11,12,15,16-decahydrocyclopenta[a]phenanthren-12-yl] 3-phenylprop-2-enoate |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(OC(CC2OC)OC3C(OC(CC3OC)OC4C(OC(CC4OC)OC5CCC6(C7CC(C8(C(CCC8(C7(CC=C6C5)O)O)(C(C)O)O)C)OC(=O)C=CC9=CC=CC=C9)C)C)C)C)O)OC)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)OC2C(OC(CC2OC)OC3C(OC(CC3OC)OC4C(OC(CC4OC)OC5CCC6(C7CC(C8(C(CCC8(C7(CC=C6C5)O)O)(C(C)O)O)C)OC(=O)C=CC9=CC=CC=C9)C)C)C)C)O)OC)O |
InChI | InChI=1S/C58H88O20/c1-30-47(61)52(69-11)48(62)53(73-30)78-51-33(4)72-46(28-40(51)68-10)77-50-32(3)71-45(27-39(50)67-9)76-49-31(2)70-44(26-38(49)66-8)74-37-20-21-54(6)36(25-37)19-22-57(64)41(54)29-42(75-43(60)18-17-35-15-13-12-14-16-35)55(7)56(63,34(5)59)23-24-58(55,57)65/h12-19,30-34,37-42,44-53,59,61-65H,20-29H2,1-11H3 |
InChI Key | IIOPSEVNHNVNNB-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C58H88O20 |
Molecular Weight | 1105.30 g/mol |
Exact Mass | 1104.58689519 g/mol |
Topological Polar Surface Area (TPSA) | 258.00 Ų |
XlogP | 3.00 |
There are no found synonyms. |
![2D Structure of [3-[5-[5-[5-(3,5-Dihydroxy-4-methoxy-6-methyloxan-2-yl)oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-8,14,17-trihydroxy-17-(1-hydroxyethyl)-10,13-dimethyl-1,2,3,4,7,9,11,12,15,16-decahydrocyclopenta[a]phenanthren-12-yl] 3-phenylprop-2-enoate 2D Structure of [3-[5-[5-[5-(3,5-Dihydroxy-4-methoxy-6-methyloxan-2-yl)oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-8,14,17-trihydroxy-17-(1-hydroxyethyl)-10,13-dimethyl-1,2,3,4,7,9,11,12,15,16-decahydrocyclopenta[a]phenanthren-12-yl] 3-phenylprop-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/ddce5bf0-849e-11ee-9819-85579fe4dbf6.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.73% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.68% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.36% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.24% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.71% | 89.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 95.71% | 96.00% |
CHEMBL2581 | P07339 | Cathepsin D | 95.23% | 98.95% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 93.05% | 94.08% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 91.17% | 95.50% |
CHEMBL5028 | O14672 | ADAM10 | 90.65% | 97.50% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 90.34% | 94.23% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.27% | 85.14% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.19% | 97.09% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 88.07% | 95.89% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 87.06% | 97.14% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 87.03% | 100.00% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 86.92% | 91.07% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 86.83% | 94.62% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.77% | 95.89% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 86.64% | 96.47% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 86.28% | 92.98% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 86.16% | 90.17% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 85.92% | 83.00% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 85.50% | 100.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.43% | 99.23% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 81.65% | 93.56% |
CHEMBL2959 | Q08881 | Tyrosine-protein kinase ITK/TSK | 80.87% | 95.00% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 80.62% | 95.93% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Araujia sericifera |
PubChem | 72998536 |
LOTUS | LTS0129856 |
wikiData | Q105113658 |