7,8,9,12,13,14,17,18,19,25-decahydroxy-24-(hydroxymethyl)-29-[3,5,7-trihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-8-yl]-3,23,26-trioxahexacyclo[13.10.3.12,6.05,10.011,28.016,21]nonacosa-5(10),6,8,11,13,15(28),16,18,20-nonaene-4,22,27-trione
Internal ID | 7dc95bb5-2c52-4344-aab5-fdc6bf2e1c08 |
Taxonomy | Phenylpropanoids and polyketides > Tannins > Complex tannins |
IUPAC Name | 7,8,9,12,13,14,17,18,19,25-decahydroxy-24-(hydroxymethyl)-29-[3,5,7-trihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-8-yl]-3,23,26-trioxahexacyclo[13.10.3.12,6.05,10.011,28.016,21]nonacosa-5(10),6,8,11,13,15(28),16,18,20-nonaene-4,22,27-trione |
SMILES (Canonical) | C1C(C(OC2=C1C(=CC(=C2C3C4C5C(C(OC(=O)C6=CC(=C(C(=C6C7=C(C(=C(C(=C7O)O)O)C8=C(C3=C(C(=C8O)O)O)C(=O)O4)C(=O)O5)O)O)O)CO)O)O)O)C9=CC(=C(C(=C9)O)O)O)O |
SMILES (Isomeric) | C1C(C(OC2=C1C(=CC(=C2C3C4C5C(C(OC(=O)C6=CC(=C(C(=C6C7=C(C(=C(C(=C7O)O)O)C8=C(C3=C(C(=C8O)O)O)C(=O)O4)C(=O)O5)O)O)O)CO)O)O)O)C9=CC(=C(C(=C9)O)O)O)O |
InChI | InChI=1S/C42H32O24/c43-6-16-28(52)39-38-23(18-11(45)5-10(44)8-3-15(49)36(64-37(8)18)7-1-12(46)26(50)13(47)2-7)22-25(41(61)65-38)21(32(56)35(59)33(22)57)20-24(42(62)66-39)19(30(54)34(58)31(20)55)17-9(40(60)63-16)4-14(48)27(51)29(17)53/h1-2,4-5,15-16,23,28,36,38-39,43-59H,3,6H2 |
InChI Key | MBFLCNJVIYQYSO-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C42H32O24 |
Molecular Weight | 920.70 g/mol |
Exact Mass | 920.12835188 g/mol |
Topological Polar Surface Area (TPSA) | 432.00 Ų |
XlogP | 1.20 |
There are no found synonyms. |
![2D Structure of 7,8,9,12,13,14,17,18,19,25-decahydroxy-24-(hydroxymethyl)-29-[3,5,7-trihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-8-yl]-3,23,26-trioxahexacyclo[13.10.3.12,6.05,10.011,28.016,21]nonacosa-5(10),6,8,11,13,15(28),16,18,20-nonaene-4,22,27-trione 2D Structure of 7,8,9,12,13,14,17,18,19,25-decahydroxy-24-(hydroxymethyl)-29-[3,5,7-trihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-8-yl]-3,23,26-trioxahexacyclo[13.10.3.12,6.05,10.011,28.016,21]nonacosa-5(10),6,8,11,13,15(28),16,18,20-nonaene-4,22,27-trione](https://plantaedb.com/storage/docs/compounds/2023/11/dd8ff300-858d-11ee-8396-6bbfa1d49e5f.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.68% | 91.11% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 97.54% | 83.82% |
CHEMBL2581 | P07339 | Cathepsin D | 94.95% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.12% | 89.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.10% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.00% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.59% | 95.56% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 88.64% | 99.15% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.95% | 94.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.64% | 94.73% |
CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 85.85% | 85.11% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.05% | 99.23% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.85% | 95.89% |
CHEMBL3820 | P35557 | Hexokinase type IV | 83.61% | 91.96% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 83.47% | 93.03% |
CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 83.26% | 96.37% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.10% | 86.33% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 82.49% | 91.49% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.96% | 100.00% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 81.90% | 96.38% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 80.97% | 85.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Terminalia catappa |
PubChem | 162928722 |
LOTUS | LTS0217005 |
wikiData | Q105160702 |