3-Amino-4-[6-[7-[30-[2-[4-(5-amino-4-hydroxy-6-methyloxan-2-yl)oxy-5-[4-(4,5-dihydroxy-6-methyloxan-2-yl)oxy-3,5-dihydroxy-6-methyloxan-2-yl]oxy-2-hydroxy-6-methyloxan-3-yl]oxy-3,5-dihydroxy-6-methyloxan-4-yl]oxy-3,5,7,11,22,24,26,32,33,34-decahydroxy-2,6,15,29-tetramethyl-18-oxo-13,17,36-trioxatricyclo[30.3.1.012,14]hexatriacont-19-en-16-yl]-4,6-dihydroxy-3,5-dimethyloctan-2-yl]oxy-2-methyl-3-[(3,4,5-trichloro-1-methylpyrrole-2-carbonyl)amino]oxan-4-yl]oxycarbonyl-1-oxidopyridin-1-ium-2-carboxylic acid
| Internal ID | 213560d6-e383-4392-9879-702ceaf0ffe1 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Oligosaccharides |
| IUPAC Name | 3-amino-4-[6-[7-[30-[2-[4-(5-amino-4-hydroxy-6-methyloxan-2-yl)oxy-5-[4-(4,5-dihydroxy-6-methyloxan-2-yl)oxy-3,5-dihydroxy-6-methyloxan-2-yl]oxy-2-hydroxy-6-methyloxan-3-yl]oxy-3,5-dihydroxy-6-methyloxan-4-yl]oxy-3,5,7,11,22,24,26,32,33,34-decahydroxy-2,6,15,29-tetramethyl-18-oxo-13,17,36-trioxatricyclo[30.3.1.012,14]hexatriacont-19-en-16-yl]-4,6-dihydroxy-3,5-dimethyloctan-2-yl]oxy-2-methyl-3-[(3,4,5-trichloro-1-methylpyrrole-2-carbonyl)amino]oxan-4-yl]oxycarbonyl-1-oxidopyridin-1-ium-2-carboxylic acid |
| SMILES (Canonical) | CC1CCC(CC(CC(CC=CC(=O)OC(C(C2C(O2)C(CCCC(C(C(CC(C(C3CC(C(C(O3)(CC1OC4C(C(OC(C4O)OC5C(C(C(OC5O)C)OC6C(C(C(C(O6)C)O)OC7CC(C(C(O7)C)O)O)O)OC8CC(C(C(O8)C)N)O)C)O)O)O)O)C)O)O)C)O)O)C)C(C)C(C(C)C(C(C)C(C)OC9CC(C(C(O9)C)NC(=O)C1=C(C(=C(N1C)Cl)Cl)Cl)OC(=O)C1=C(C(=[N+](C=C1)[O-])C(=O)O)N)O)O)O)O)O |
| SMILES (Isomeric) | CC1CCC(CC(CC(CC=CC(=O)OC(C(C2C(O2)C(CCCC(C(C(CC(C(C3CC(C(C(O3)(CC1OC4C(C(OC(C4O)OC5C(C(C(OC5O)C)OC6C(C(C(C(O6)C)O)OC7CC(C(C(O7)C)O)O)O)OC8CC(C(C(O8)C)N)O)C)O)O)O)O)C)O)O)C)O)O)C)C(C)C(C(C)C(C(C)C(C)OC9CC(C(C(O9)C)NC(=O)C1=C(C(=C(N1C)Cl)Cl)Cl)OC(=O)C1=C(C(=[N+](C=C1)[O-])C(=O)O)N)O)O)O)O)O |
| InChI | InChI=1S/C96H154Cl3N5O42/c1-34-22-23-49(106)27-50(107)26-48(105)18-16-21-62(115)140-80(39(6)74(117)38(5)73(116)35(2)41(8)131-65-32-60(139-92(127)51-24-25-104(130)72(69(51)101)91(125)126)70(43(10)133-65)102-90(124)71-66(97)67(98)89(99)103(71)15)40(7)81-83(143-81)53(109)20-17-19-52(108)36(3)54(110)28-55(111)37(4)59-29-58(114)88(123)96(129,146-59)33-61(34)138-84-76(119)45(12)137-95(78(84)121)145-87-86(142-63-30-56(112)68(100)42(9)132-63)82(47(14)135-93(87)128)144-94-79(122)85(77(120)46(13)136-94)141-64-31-57(113)75(118)44(11)134-64/h16,21,24-25,34-50,52-61,63-65,68,70,73-88,93-95,105-114,116-123,128-129H,17-20,22-23,26-33,100-101H2,1-15H3,(H,102,124)(H,125,126) |
| InChI Key | ZFZPBUDXKXGHLD-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C96H154Cl3N5O42 |
| Molecular Weight | 2156.60 g/mol |
| Exact Mass | 2154.916752 g/mol |
| Topological Polar Surface Area (TPSA) | 739.00 Ų |
| XlogP | -1.80 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1914 | P06276 | Butyrylcholinesterase | 99.26% | 95.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.55% | 94.45% |
| CHEMBL4072 | P07858 | Cathepsin B | 98.29% | 93.67% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 98.14% | 96.38% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 98.02% | 96.77% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.94% | 96.09% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 96.08% | 95.17% |
| CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 95.95% | 87.67% |
| CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 94.96% | 83.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 94.59% | 95.89% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.53% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.18% | 98.95% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 94.05% | 93.56% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 93.62% | 90.00% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 93.03% | 100.00% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 92.79% | 97.36% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.60% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.38% | 86.33% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 92.35% | 97.33% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 90.08% | 94.42% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 89.83% | 91.19% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.14% | 97.09% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.61% | 89.00% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 87.23% | 89.50% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.07% | 90.71% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 86.07% | 95.93% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 85.63% | 96.90% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.56% | 99.23% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 85.04% | 91.07% |
| CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR | 84.52% | 92.78% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 84.51% | 93.00% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 84.07% | 97.14% |
| CHEMBL3384 | Q16512 | Protein kinase N1 | 83.93% | 80.71% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 83.80% | 92.29% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 83.55% | 91.03% |
| CHEMBL5028 | O14672 | ADAM10 | 83.40% | 97.50% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 83.08% | 97.25% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 82.50% | 96.47% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 82.49% | 92.50% |
| CHEMBL3837 | P07711 | Cathepsin L | 81.36% | 96.61% |
| CHEMBL2959 | Q08881 | Tyrosine-protein kinase ITK/TSK | 81.11% | 95.00% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.65% | 96.00% |
| CHEMBL3572 | P11597 | Cholesteryl ester transfer protein | 80.01% | 92.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163196091 |
| LOTUS | LTS0207335 |
| wikiData | Q104202368 |