[3,4,5-Trihydroxy-6-[4-(2-hydroxypropan-2-yl)cyclohexene-1-carbonyl]oxyoxan-2-yl]methyl 3,4,5-trihydroxybenzoate
Internal ID | 1c50863c-d64b-4ba2-96a3-42ef349f34ae |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides |
IUPAC Name | [3,4,5-trihydroxy-6-[4-(2-hydroxypropan-2-yl)cyclohexene-1-carbonyl]oxyoxan-2-yl]methyl 3,4,5-trihydroxybenzoate |
SMILES (Canonical) | CC(C)(C1CCC(=CC1)C(=O)OC2C(C(C(C(O2)COC(=O)C3=CC(=C(C(=C3)O)O)O)O)O)O)O |
SMILES (Isomeric) | CC(C)(C1CCC(=CC1)C(=O)OC2C(C(C(C(O2)COC(=O)C3=CC(=C(C(=C3)O)O)O)O)O)O)O |
InChI | InChI=1S/C23H30O12/c1-23(2,32)12-5-3-10(4-6-12)21(31)35-22-19(29)18(28)17(27)15(34-22)9-33-20(30)11-7-13(24)16(26)14(25)8-11/h3,7-8,12,15,17-19,22,24-29,32H,4-6,9H2,1-2H3 |
InChI Key | DLZSLMKHPDKBHG-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C23H30O12 |
Molecular Weight | 498.50 g/mol |
Exact Mass | 498.17372639 g/mol |
Topological Polar Surface Area (TPSA) | 203.00 Ų |
XlogP | 0.00 |
There are no found synonyms. |
![2D Structure of [3,4,5-Trihydroxy-6-[4-(2-hydroxypropan-2-yl)cyclohexene-1-carbonyl]oxyoxan-2-yl]methyl 3,4,5-trihydroxybenzoate 2D Structure of [3,4,5-Trihydroxy-6-[4-(2-hydroxypropan-2-yl)cyclohexene-1-carbonyl]oxyoxan-2-yl]methyl 3,4,5-trihydroxybenzoate](https://plantaedb.com/storage/docs/compounds/2023/11/dd4c4460-86a3-11ee-a6b0-9f10efd06683.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.60% | 91.11% |
CHEMBL3401 | O75469 | Pregnane X receptor | 94.59% | 94.73% |
CHEMBL2581 | P07339 | Cathepsin D | 93.10% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.05% | 96.09% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 91.33% | 92.50% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.03% | 99.17% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.13% | 94.00% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 88.96% | 83.00% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 88.75% | 97.25% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.30% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.20% | 86.33% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.04% | 97.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.14% | 95.89% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 85.96% | 95.64% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.42% | 95.89% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.06% | 100.00% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 83.87% | 89.34% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 82.80% | 94.33% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.81% | 92.62% |
CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 80.64% | 90.24% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.35% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Eucalyptus globulus |
PubChem | 74327557 |
LOTUS | LTS0270879 |
wikiData | Q104984919 |