(1R,2R,20R,42S,46R)-15-[(1R,2S,20S,42S,46S)-7,8,9,12,13,14,20,25,26,27,30,31,32,35,36,37-hexadecahydroxy-4,17,22,40,44-pentaoxo-3,18,21,41,43-pentaoxanonacyclo[27.13.3.138,42.02,20.05,10.011,16.023,28.033,45.034,39]hexatetraconta-5,7,9,11,13,15,23,25,27,29(45),30,32,34(39),35,37-pentadecaen-46-yl]-7,8,9,12,13,14,25,26,27,30,31,32,35,36,37,46-hexadecahydroxy-3,18,21,41,43-pentaoxanonacyclo[27.13.3.138,42.02,20.05,10.011,16.023,28.033,45.034,39]hexatetraconta-5,7,9,11(16),12,14,23,25,27,29(45),30,32,34(39),35,37-pentadecaene-4,17,22,40,44-pentone
Internal ID | 0a1d78af-4361-429a-b2f1-43dbd42556f8 |
Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
IUPAC Name | (1R,2R,20R,42S,46R)-15-[(1R,2S,20S,42S,46S)-7,8,9,12,13,14,20,25,26,27,30,31,32,35,36,37-hexadecahydroxy-4,17,22,40,44-pentaoxo-3,18,21,41,43-pentaoxanonacyclo[27.13.3.138,42.02,20.05,10.011,16.023,28.033,45.034,39]hexatetraconta-5,7,9,11,13,15,23,25,27,29(45),30,32,34(39),35,37-pentadecaen-46-yl]-7,8,9,12,13,14,25,26,27,30,31,32,35,36,37,46-hexadecahydroxy-3,18,21,41,43-pentaoxanonacyclo[27.13.3.138,42.02,20.05,10.011,16.023,28.033,45.034,39]hexatetraconta-5,7,9,11(16),12,14,23,25,27,29(45),30,32,34(39),35,37-pentadecaene-4,17,22,40,44-pentone |
SMILES (Canonical) | C1C2C(C3C4C(C5=C(C(=C(C(=C5C(=O)O4)C6=C(C(=C(C(=C6C(=O)O3)C7=C(C(=C(C=C7C(=O)O2)O)O)O)O)O)O)O)O)O)O)OC(=O)C8=CC(=C(C(=C8C9=C(C(=C(C(=C9O)O)O)C2C3C4C5C(COC(=O)C6=CC(=C(C(=C6C6=C(C(=C(C=C6C(=O)O5)O)O)O)O)O)O)(OC(=O)C5=CC(=C(C(=C5C5=C(C(=C(C(=C5O)O)O)C5=C(C2=C(C(=C5O)O)O)C(=O)O3)C(=O)O4)O)O)O)O)C(=O)O1)O)O)O |
SMILES (Isomeric) | C1[C@@H]2[C@H]([C@H]3[C@@H]4[C@@H](C5=C(C(=C(C(=C5C(=O)O4)C6=C(C(=C(C(=C6C(=O)O3)C7=C(C(=C(C=C7C(=O)O2)O)O)O)O)O)O)O)O)O)O)OC(=O)C8=CC(=C(C(=C8C9=C(C(=C(C(=C9O)O)O)[C@@H]2[C@H]3[C@@H]4[C@H]5[C@](COC(=O)C6=CC(=C(C(=C6C6=C(C(=C(C=C6C(=O)O5)O)O)O)O)O)O)(OC(=O)C5=CC(=C(C(=C5C5=C(C(=C(C(=C5O)O)O)C5=C(C2=C(C(=C5O)O)O)C(=O)O3)C(=O)O4)O)O)O)O)C(=O)O1)O)O)O |
InChI | InChI=1S/C82H50O52/c83-13-1-8-19(45(93)40(13)88)20-9(2-14(84)41(89)46(20)94)75(117)133-71-70-67-33(32-37(78(120)129-67)28(54(102)64(112)58(32)106)27-36(80(122)132-70)26(52(100)62(110)53(27)101)23-12(5-17(87)44(92)49(23)97)76(118)134-82(71,124)7-126-72(8)114)31-34-24(50(98)63(111)57(31)105)22-11(4-16(86)43(91)48(22)96)74(116)128-66-18(6-125-77(34)119)127-73(115)10-3-15(85)42(90)47(95)21(10)25-35-29(55(103)61(109)51(25)99)30-38-39(59(107)65(113)56(30)104)60(108)68(130-81(38)123)69(66)131-79(35)121/h1-5,18,33,60,66-71,83-113,124H,6-7H2/t18-,33+,60-,66-,67+,68+,69+,70-,71+,82+/m1/s1 |
InChI Key | MVSUDPQBKNOTEZ-WIAYDVRRSA-N |
Popularity | 0 references in papers |
Molecular Formula | C82H50O52 |
Molecular Weight | 1867.20 g/mol |
Exact Mass | 1866.1268118 g/mol |
Topological Polar Surface Area (TPSA) | 910.00 Ų |
XlogP | 1.80 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.27% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.67% | 85.14% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.13% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.96% | 95.56% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 91.92% | 96.38% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 91.04% | 82.69% |
CHEMBL2581 | P07339 | Cathepsin D | 89.45% | 98.95% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.01% | 94.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.40% | 99.23% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 88.40% | 96.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.54% | 99.15% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 87.25% | 93.40% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 86.48% | 93.03% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.87% | 97.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.56% | 95.89% |
CHEMBL4530 | P00488 | Coagulation factor XIII | 82.76% | 96.00% |
CHEMBL2535 | P11166 | Glucose transporter | 82.63% | 98.75% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.20% | 100.00% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 81.51% | 91.07% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Quercus robur |
PubChem | 163192207 |
LOTUS | LTS0198666 |
wikiData | Q105173273 |