[(1S,3R,13R,14S,17S,18R,19R,20R,21S,22R,23R,24R,25S)-18,21,22,24-tetraacetyloxy-20-(acetyloxymethyl)-25-hydroxy-3,13,14,25-tetramethyl-6,15-dioxo-2,5,16-trioxa-11-azapentacyclo[15.7.1.01,20.03,23.07,12]pentacosa-7(12),8,10-trien-19-yl] 1-methyl-6-oxopyridine-3-carboxylate
| Internal ID | 3ba0d852-bf0a-4b05-be89-f089ce5471da |
| Taxonomy | Alkaloids and derivatives |
| IUPAC Name | [(1S,3R,13R,14S,17S,18R,19R,20R,21S,22R,23R,24R,25S)-18,21,22,24-tetraacetyloxy-20-(acetyloxymethyl)-25-hydroxy-3,13,14,25-tetramethyl-6,15-dioxo-2,5,16-trioxa-11-azapentacyclo[15.7.1.01,20.03,23.07,12]pentacosa-7(12),8,10-trien-19-yl] 1-methyl-6-oxopyridine-3-carboxylate |
| SMILES (Canonical) | CC1C(C(=O)OC2C(C(C3(C(C(C4C(C3(C2(C)O)OC4(COC(=O)C5=C1N=CC=C5)C)OC(=O)C)OC(=O)C)OC(=O)C)COC(=O)C)OC(=O)C6=CN(C(=O)C=C6)C)OC(=O)C)C |
| SMILES (Isomeric) | C[C@@H]1[C@@H](C(=O)O[C@H]2[C@@H]([C@@H]([C@]3([C@@H]([C@@H]([C@@H]4[C@H]([C@@]3([C@@]2(C)O)O[C@]4(COC(=O)C5=C1N=CC=C5)C)OC(=O)C)OC(=O)C)OC(=O)C)COC(=O)C)OC(=O)C6=CN(C(=O)C=C6)C)OC(=O)C)C |
| InChI | InChI=1S/C43H50N2O19/c1-19-20(2)37(52)62-34-32(59-23(5)48)36(63-38(53)26-13-14-28(51)45(10)16-26)42(18-56-21(3)46)35(61-25(7)50)31(58-22(4)47)29-33(60-24(6)49)43(42,41(34,9)55)64-40(29,8)17-57-39(54)27-12-11-15-44-30(19)27/h11-16,19-20,29,31-36,55H,17-18H2,1-10H3/t19-,20+,29-,31-,32+,33-,34+,35-,36+,40+,41+,42-,43+/m1/s1 |
| InChI Key | XORHGUAWVKAJST-XUAFCPGYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C43H50N2O19 |
| Molecular Weight | 898.90 g/mol |
| Exact Mass | 898.30077737 g/mol |
| Topological Polar Surface Area (TPSA) | 273.00 Ų |
| XlogP | 0.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 99.00% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.62% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 98.16% | 98.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 98.11% | 86.33% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.26% | 85.14% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 97.25% | 91.49% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 94.81% | 81.11% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 94.34% | 93.10% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 92.85% | 96.77% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.81% | 94.00% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 92.18% | 94.42% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 92.00% | 82.69% |
| CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 90.40% | 96.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 89.26% | 90.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.85% | 89.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.73% | 99.23% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 87.36% | 93.00% |
| CHEMBL3891 | P07384 | Calpain 1 | 86.22% | 93.04% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.13% | 95.89% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 85.39% | 95.17% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 84.63% | 96.90% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 82.66% | 89.34% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 81.82% | 97.79% |
| CHEMBL5028 | O14672 | ADAM10 | 81.62% | 97.50% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.60% | 95.56% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 81.21% | 96.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Semialarium mexicanum |
| PubChem | 162855351 |
| LOTUS | LTS0075995 |
| wikiData | Q105337888 |