(1R,8S,12R)-12-[(4-hydroxy-3-methoxyphenyl)methyl]-4-methoxy-9-oxatricyclo[6.2.2.02,7]dodeca-2,4,6-trien-5-ol
Internal ID | 35f50d17-fce0-4b5c-a70e-d994e1979d06 |
Taxonomy | Benzenoids > Tetralins |
IUPAC Name | (1R,8S,12R)-12-[(4-hydroxy-3-methoxyphenyl)methyl]-4-methoxy-9-oxatricyclo[6.2.2.02,7]dodeca-2,4,6-trien-5-ol |
SMILES (Canonical) | COC1=C(C=CC(=C1)CC2CC3COC2C4=CC(=C(C=C34)OC)O)O |
SMILES (Isomeric) | COC1=C(C=CC(=C1)C[C@H]2C[C@H]3CO[C@@H]2C4=CC(=C(C=C34)OC)O)O |
InChI | InChI=1S/C20H22O5/c1-23-18-6-11(3-4-16(18)21)5-12-7-13-10-25-20(12)15-8-17(22)19(24-2)9-14(13)15/h3-4,6,8-9,12-13,20-22H,5,7,10H2,1-2H3/t12-,13-,20-/m0/s1 |
InChI Key | LOHDMDZVDAWZCR-QAJFTPDKSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H22O5 |
Molecular Weight | 342.40 g/mol |
Exact Mass | 342.14672380 g/mol |
Topological Polar Surface Area (TPSA) | 68.20 Ų |
XlogP | 3.00 |
There are no found synonyms. |
![2D Structure of (1R,8S,12R)-12-[(4-hydroxy-3-methoxyphenyl)methyl]-4-methoxy-9-oxatricyclo[6.2.2.02,7]dodeca-2,4,6-trien-5-ol 2D Structure of (1R,8S,12R)-12-[(4-hydroxy-3-methoxyphenyl)methyl]-4-methoxy-9-oxatricyclo[6.2.2.02,7]dodeca-2,4,6-trien-5-ol](https://plantaedb.com/storage/docs/compounds/2023/11/dd26d420-8623-11ee-8688-a9a093f1586a.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.67% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.67% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.53% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 91.50% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.82% | 86.33% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 90.08% | 92.62% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.92% | 99.17% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.68% | 95.89% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 86.10% | 97.25% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.97% | 94.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.62% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.10% | 95.56% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 84.34% | 97.14% |
CHEMBL261 | P00915 | Carbonic anhydrase I | 83.93% | 96.76% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 82.79% | 89.62% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.77% | 92.94% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.10% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Viburnum foetidum |
PubChem | 163101427 |
LOTUS | LTS0134710 |
wikiData | Q105154705 |