7-[[3-[(3,6-dihydroxy-5-oxo-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-2-yl)oxy]-6-hydroxy-5-oxo-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-2-yl]oxy]-2-(3,4-dihydroxyphenyl)-5-hydroxy-2,3-dihydrochromen-4-one
Internal ID | b28412e5-6ac9-4b33-b530-bff3308d623f |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | 7-[[3-[(3,6-dihydroxy-5-oxo-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-2-yl)oxy]-6-hydroxy-5-oxo-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-2-yl]oxy]-2-(3,4-dihydroxyphenyl)-5-hydroxy-2,3-dihydrochromen-4-one |
SMILES (Canonical) | C1C(OC2=CC(=CC(=C2C1=O)O)OC3C(C4C(O3)C(C(=O)O4)O)OC5C(C6C(O5)C(C(=O)O6)O)O)C7=CC(=C(C=C7)O)O |
SMILES (Isomeric) | C1C(OC2=CC(=CC(=C2C1=O)O)OC3C(C4C(O3)C(C(=O)O4)O)OC5C(C6C(O5)C(C(=O)O6)O)O)C7=CC(=C(C=C7)O)O |
InChI | InChI=1S/C27H24O16/c28-9-2-1-7(3-10(9)29)13-6-12(31)15-11(30)4-8(5-14(15)38-13)37-27-23(22-20(42-27)17(33)25(36)40-22)43-26-18(34)21-19(41-26)16(32)24(35)39-21/h1-5,13,16-23,26-30,32-34H,6H2 |
InChI Key | QLCNJZHWGARWON-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C27H24O16 |
Molecular Weight | 604.50 g/mol |
Exact Mass | 604.10643467 g/mol |
Topological Polar Surface Area (TPSA) | 237.00 Ų |
XlogP | -0.40 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.53% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.18% | 94.45% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 93.70% | 99.15% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.73% | 97.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.15% | 89.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.88% | 96.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.03% | 95.89% |
CHEMBL4208 | P20618 | Proteasome component C5 | 89.28% | 90.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.47% | 95.56% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.92% | 99.23% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 87.77% | 94.80% |
CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 86.84% | 92.68% |
CHEMBL2581 | P07339 | Cathepsin D | 86.74% | 98.95% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.42% | 90.71% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.59% | 94.00% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 83.73% | 95.78% |
CHEMBL3401 | O75469 | Pregnane X receptor | 83.66% | 94.73% |
CHEMBL3194 | P02766 | Transthyretin | 82.95% | 90.71% |
CHEMBL4531 | P17931 | Galectin-3 | 82.66% | 96.90% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 82.49% | 96.21% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.46% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Perilla frutescens |
PubChem | 163015734 |
LOTUS | LTS0200764 |
wikiData | Q105223490 |