methyl 2-[(1S,2R,5R,6R,10R,11S,12R,13R,14R,17S,18S)-12,14,17-triacetyloxy-6-(furan-3-yl)-11-hydroxy-1,5,15-trimethyl-8-oxo-7-oxapentacyclo[13.2.1.02,11.05,10.013,17]octadecan-18-yl]acetate
| Internal ID | b37b8e38-4506-4e8d-8d9f-29ca96c71716 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids > Limonoids |
| IUPAC Name | methyl 2-[(1S,2R,5R,6R,10R,11S,12R,13R,14R,17S,18S)-12,14,17-triacetyloxy-6-(furan-3-yl)-11-hydroxy-1,5,15-trimethyl-8-oxo-7-oxapentacyclo[13.2.1.02,11.05,10.013,17]octadecan-18-yl]acetate |
| SMILES (Canonical) | CC(=O)OC1C2C(C3(C(CCC4(C3CC(=O)OC4C5=COC=C5)C)C6(C2(CC1(C6CC(=O)OC)C)OC(=O)C)C)O)OC(=O)C |
| SMILES (Isomeric) | CC(=O)O[C@@H]1[C@H]2[C@H](C3(C[C@]2([C@@]([C@H]3CC(=O)OC)([C@@H]4[C@]1([C@@H]5CC(=O)O[C@H]([C@@]5(CC4)C)C6=COC=C6)O)C)OC(=O)C)C)OC(=O)C |
| InChI | InChI=1S/C33H42O12/c1-16(34)42-27-25-28(43-17(2)35)33(39)20(8-10-29(4)22(33)13-24(38)44-26(29)19-9-11-41-14-19)31(6)21(12-23(37)40-7)30(27,5)15-32(25,31)45-18(3)36/h9,11,14,20-22,25-28,39H,8,10,12-13,15H2,1-7H3/t20-,21+,22-,25-,26+,27-,28-,29-,30?,31-,32+,33-/m1/s1 |
| InChI Key | VGUYBWJXTOTJBG-HECKSNOTSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C33H42O12 |
| Molecular Weight | 630.70 g/mol |
| Exact Mass | 630.26762677 g/mol |
| Topological Polar Surface Area (TPSA) | 165.00 Ų |
| XlogP | 2.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.78% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.63% | 94.45% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.48% | 85.14% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.00% | 96.09% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 95.52% | 83.82% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 94.63% | 97.79% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.17% | 98.95% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.60% | 97.25% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.52% | 86.33% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 87.12% | 92.62% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.59% | 97.09% |
| CHEMBL5028 | O14672 | ADAM10 | 86.07% | 97.50% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.00% | 95.89% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 85.79% | 95.71% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.40% | 89.00% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 84.44% | 94.33% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 84.40% | 91.24% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 84.35% | 97.14% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.30% | 100.00% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 83.96% | 93.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.56% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Xylocarpus granatum |
| PubChem | 102086516 |
| LOTUS | LTS0157388 |
| wikiData | Q105286094 |