2-[[3-[(6-chloro-5-hydroxy-1H-indol-3-yl)methyl]-7,12-dimethyl-6,9-bis(2-methylpropyl)-2,5,8,11,14-pentaoxo-1,4,7,10,13-pentazacyclononadec-15-yl]carbamoylamino]-5-(diaminomethylideneamino)pentanoic acid
| Internal ID | 0bdca145-bf59-45bf-aa15-ab2b2c5473ad |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Oligopeptides |
| IUPAC Name | 2-[[3-[(6-chloro-5-hydroxy-1H-indol-3-yl)methyl]-7,12-dimethyl-6,9-bis(2-methylpropyl)-2,5,8,11,14-pentaoxo-1,4,7,10,13-pentazacyclononadec-15-yl]carbamoylamino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES (Canonical) | CC1C(=O)NC(C(=O)N(C(C(=O)NC(C(=O)NCCCCC(C(=O)N1)NC(=O)NC(CCCN=C(N)N)C(=O)O)CC2=CNC3=CC(=C(C=C32)O)Cl)CC(C)C)C)CC(C)C |
| SMILES (Isomeric) | CC1C(=O)NC(C(=O)N(C(C(=O)NC(C(=O)NCCCCC(C(=O)N1)NC(=O)NC(CCCN=C(N)N)C(=O)O)CC2=CNC3=CC(=C(C=C32)O)Cl)CC(C)C)C)CC(C)C |
| InChI | InChI=1S/C40H62ClN11O9/c1-20(2)14-30-37(58)52(6)31(15-21(3)4)36(57)48-29(16-23-19-46-28-18-25(41)32(53)17-24(23)28)34(55)44-12-8-7-10-26(35(56)47-22(5)33(54)49-30)50-40(61)51-27(38(59)60)11-9-13-45-39(42)43/h17-22,26-27,29-31,46,53H,7-16H2,1-6H3,(H,44,55)(H,47,56)(H,48,57)(H,49,54)(H,59,60)(H4,42,43,45)(H2,50,51,61) |
| InChI Key | SBRDICXOWWETEM-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C40H62ClN11O9 |
| Molecular Weight | 876.40 g/mol |
| Exact Mass | 875.4420503 g/mol |
| Topological Polar Surface Area (TPSA) | 316.00 Ų |
| XlogP | 2.20 |
| Atomic LogP (AlogP) | 0.94 |
| H-Bond Acceptor | 9 |
| H-Bond Donor | 11 |
| Rotatable Bonds | 13 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.9340 | 93.40% |
| Caco-2 | - | 0.8647 | 86.47% |
| Blood Brain Barrier | - | 0.6750 | 67.50% |
| Human oral bioavailability | - | 0.6714 | 67.14% |
| Subcellular localzation | Lysosomes | 0.3817 | 38.17% |
| OATP2B1 inhibitior | - | 0.7133 | 71.33% |
| OATP1B1 inhibitior | + | 0.8217 | 82.17% |
| OATP1B3 inhibitior | + | 0.9347 | 93.47% |
| MATE1 inhibitior | - | 0.8200 | 82.00% |
| OCT2 inhibitior | - | 0.7250 | 72.50% |
| BSEP inhibitior | + | 0.9478 | 94.78% |
| P-glycoprotein inhibitior | + | 0.7445 | 74.45% |
| P-glycoprotein substrate | + | 0.8560 | 85.60% |
| CYP3A4 substrate | + | 0.7432 | 74.32% |
| CYP2C9 substrate | - | 0.6062 | 60.62% |
| CYP2D6 substrate | - | 0.8316 | 83.16% |
| CYP3A4 inhibition | - | 0.6352 | 63.52% |
| CYP2C9 inhibition | - | 0.7148 | 71.48% |
| CYP2C19 inhibition | - | 0.6648 | 66.48% |
| CYP2D6 inhibition | - | 0.8315 | 83.15% |
| CYP1A2 inhibition | - | 0.7424 | 74.24% |
| CYP2C8 inhibition | + | 0.6854 | 68.54% |
| CYP inhibitory promiscuity | - | 0.8740 | 87.40% |
| UGT catelyzed | + | 0.7000 | 70.00% |
| Carcinogenicity (binary) | - | 0.7400 | 74.00% |
| Carcinogenicity (trinary) | Non-required | 0.5946 | 59.46% |
| Eye corrosion | - | 0.9826 | 98.26% |
| Eye irritation | - | 0.9055 | 90.55% |
| Skin irritation | - | 0.7629 | 76.29% |
| Skin corrosion | - | 0.9207 | 92.07% |
| Ames mutagenesis | - | 0.6300 | 63.00% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.4617 | 46.17% |
| Micronuclear | + | 0.8400 | 84.00% |
| Hepatotoxicity | - | 0.5693 | 56.93% |
| skin sensitisation | - | 0.8444 | 84.44% |
| Respiratory toxicity | + | 0.8444 | 84.44% |
| Reproductive toxicity | + | 0.9222 | 92.22% |
| Mitochondrial toxicity | + | 0.8750 | 87.50% |
| Nephrotoxicity | + | 0.4583 | 45.83% |
| Acute Oral Toxicity (c) | III | 0.5952 | 59.52% |
| Estrogen receptor binding | + | 0.8167 | 81.67% |
| Androgen receptor binding | + | 0.6351 | 63.51% |
| Thyroid receptor binding | + | 0.6024 | 60.24% |
| Glucocorticoid receptor binding | - | 0.5072 | 50.72% |
| Aromatase binding | + | 0.6843 | 68.43% |
| PPAR gamma | + | 0.7541 | 75.41% |
| Honey bee toxicity | - | 0.7421 | 74.21% |
| Biodegradation | - | 0.7500 | 75.00% |
| Crustacea aquatic toxicity | - | 0.5352 | 53.52% |
| Fish aquatic toxicity | + | 0.9697 | 96.97% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.71% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.69% | 91.11% |
| CHEMBL204 | P00734 | Thrombin | 99.05% | 96.01% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.86% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.68% | 94.45% |
| CHEMBL4072 | P07858 | Cathepsin B | 96.71% | 93.67% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 95.73% | 88.42% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 94.04% | 98.33% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 94.02% | 93.10% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 93.91% | 90.71% |
| CHEMBL4608 | P33032 | Melanocortin receptor 5 | 93.68% | 97.00% |
| CHEMBL3155 | P34969 | Serotonin 7 (5-HT7) receptor | 93.17% | 90.71% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 92.65% | 94.75% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 92.53% | 83.82% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 92.46% | 95.38% |
| CHEMBL4644 | P41968 | Melanocortin receptor 3 | 92.38% | 99.52% |
| CHEMBL4835 | P00338 | L-lactate dehydrogenase A chain | 92.23% | 95.34% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 91.78% | 89.62% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 91.48% | 95.56% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.38% | 97.09% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 91.20% | 93.56% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 90.89% | 89.50% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 89.98% | 96.11% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 89.93% | 90.08% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 89.89% | 92.88% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 89.26% | 99.15% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 89.00% | 96.47% |
| CHEMBL3384 | Q16512 | Protein kinase N1 | 88.89% | 80.71% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 88.52% | 95.50% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 88.50% | 96.90% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 88.49% | 95.00% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.31% | 96.00% |
| CHEMBL3729 | P22748 | Carbonic anhydrase IV | 88.27% | 99.23% |
| CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 88.19% | 96.31% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 87.89% | 95.62% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 87.80% | 100.00% |
| CHEMBL261 | P00915 | Carbonic anhydrase I | 87.71% | 96.76% |
| CHEMBL3837 | P07711 | Cathepsin L | 86.74% | 96.61% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 86.70% | 97.23% |
| CHEMBL1949 | P62937 | Cyclophilin A | 86.38% | 98.57% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 86.22% | 95.93% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 85.56% | 96.21% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 85.41% | 93.03% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.20% | 95.56% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 85.06% | 98.05% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 84.61% | 90.17% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.58% | 95.89% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 83.66% | 98.59% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 83.26% | 96.61% |
| CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 83.18% | 92.32% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 83.10% | 97.50% |
| CHEMBL2083 | P15090 | Fatty acid binding protein adipocyte | 82.46% | 95.71% |
| CHEMBL1075317 | P61964 | WD repeat-containing protein 5 | 82.10% | 96.33% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 81.95% | 98.24% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.90% | 91.19% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 81.75% | 97.64% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 81.68% | 100.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.05% | 86.33% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 80.65% | 90.24% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 72819069 |
| LOTUS | LTS0014338 |
| wikiData | Q105249633 |