[6-[[2-(3,4-dihydroxyphenyl)-3,7-dihydroxy-3,4-dihydro-2H-chromen-5-yl]oxy]-3,4-dihydroxy-5-[3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyloxy]oxan-2-yl]methyl 3-(4-hydroxyphenyl)prop-2-enoate
Internal ID | 563e207e-6550-4f41-b1d9-6f7490cc87b5 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid 5-O-p-coumaroyl glycosides |
IUPAC Name | [6-[[2-(3,4-dihydroxyphenyl)-3,7-dihydroxy-3,4-dihydro-2H-chromen-5-yl]oxy]-3,4-dihydroxy-5-[3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyloxy]oxan-2-yl]methyl 3-(4-hydroxyphenyl)prop-2-enoate |
SMILES (Canonical) | COC1=C(C=CC(=C1)C=CC(=O)OC2C(C(C(OC2OC3=CC(=CC4=C3CC(C(O4)C5=CC(=C(C=C5)O)O)O)O)COC(=O)C=CC6=CC=C(C=C6)O)O)O)O |
SMILES (Isomeric) | COC1=C(C=CC(=C1)C=CC(=O)OC2C(C(C(OC2OC3=CC(=CC4=C3CC(C(O4)C5=CC(=C(C=C5)O)O)O)O)COC(=O)C=CC6=CC=C(C=C6)O)O)O)O |
InChI | InChI=1S/C40H38O16/c1-51-32-14-21(4-10-27(32)44)6-13-35(48)56-39-37(50)36(49)33(19-52-34(47)12-5-20-2-8-23(41)9-3-20)55-40(39)54-31-17-24(42)16-30-25(31)18-29(46)38(53-30)22-7-11-26(43)28(45)15-22/h2-17,29,33,36-46,49-50H,18-19H2,1H3 |
InChI Key | DFZHDDNFAQXALN-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C40H38O16 |
Molecular Weight | 774.70 g/mol |
Exact Mass | 774.21598512 g/mol |
Topological Polar Surface Area (TPSA) | 251.00 Ų |
XlogP | 3.60 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.78% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.43% | 96.09% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 99.30% | 91.49% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.91% | 86.33% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.86% | 97.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.65% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.44% | 95.56% |
CHEMBL3194 | P02766 | Transthyretin | 93.58% | 90.71% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 93.45% | 96.00% |
CHEMBL4630 | O14757 | Serine/threonine-protein kinase Chk1 | 93.37% | 97.03% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.46% | 94.45% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.86% | 99.17% |
CHEMBL4208 | P20618 | Proteasome component C5 | 89.12% | 90.00% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 88.51% | 83.82% |
CHEMBL3401 | O75469 | Pregnane X receptor | 88.39% | 94.73% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 86.12% | 95.50% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 85.67% | 95.89% |
CHEMBL3438 | Q05513 | Protein kinase C zeta | 84.88% | 88.48% |
CHEMBL2581 | P07339 | Cathepsin D | 83.04% | 98.95% |
CHEMBL2535 | P11166 | Glucose transporter | 82.31% | 98.75% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 82.24% | 92.50% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.77% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cinnamomum bejolghota |
PubChem | 73818236 |
LOTUS | LTS0208385 |
wikiData | Q104978467 |