(1R,3aS,5S,5aR,5bS,7aS,9R,11aR,11bR,13aR,13bR)-5,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-9-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3,4,5,5a,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydro-1H-cyclopenta[a]chrysene-3a-carboxylic acid
| Internal ID | 815fdca4-6959-4503-8d25-5b8c6cb4a05e |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides |
| IUPAC Name | (1R,3aS,5S,5aR,5bS,7aS,9R,11aR,11bR,13aR,13bR)-5,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-9-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3,4,5,5a,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydro-1H-cyclopenta[a]chrysene-3a-carboxylic acid |
| SMILES (Canonical) | CC1CC2(CCC(C2C3C1C4(CCC5C(C(CCC5(C4CC3)C)OC6C(C(C(C(O6)CO)O)O)O)(C)C)C)C(=C)C)C(=O)O |
| SMILES (Isomeric) | C[C@H]1C[C@]2(CC[C@H]([C@H]2[C@H]3[C@@H]1[C@@]4(CC[C@H]5[C@@]([C@@H]4CC3)(CC[C@H](C5(C)C)O[C@@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O)C)C)C(=C)C)C(=O)O |
| InChI | InChI=1S/C36H58O8/c1-18(2)20-10-15-36(32(41)42)16-19(3)26-21(27(20)36)8-9-24-34(6)14-12-25(33(4,5)23(34)11-13-35(24,26)7)44-31-30(40)29(39)28(38)22(17-37)43-31/h19-31,37-40H,1,8-17H2,2-7H3,(H,41,42)/t19-,20-,21+,22+,23+,24-,25+,26+,27-,28+,29-,30+,31+,34-,35+,36-/m0/s1 |
| InChI Key | JYXYOLLEHMLZDH-RPDVKDJZSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C36H58O8 |
| Molecular Weight | 618.80 g/mol |
| Exact Mass | 618.41316880 g/mol |
| Topological Polar Surface Area (TPSA) | 137.00 Ų |
| XlogP | 6.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.25% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.92% | 91.11% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 93.42% | 96.61% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 90.12% | 96.38% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 89.89% | 97.25% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.60% | 97.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.37% | 98.95% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 87.31% | 92.50% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 87.23% | 98.10% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 84.69% | 95.93% |
| CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 84.63% | 82.50% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.21% | 99.17% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.16% | 86.33% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.28% | 89.00% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 83.19% | 95.50% |
| CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 81.87% | 96.09% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 81.80% | 96.21% |
| CHEMBL5028 | O14672 | ADAM10 | 81.79% | 97.50% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.83% | 100.00% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.77% | 100.00% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.67% | 91.19% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.63% | 95.89% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 80.49% | 100.00% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 80.25% | 93.00% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.07% | 94.33% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.02% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163027430 |
| LOTUS | LTS0135410 |
| wikiData | Q105137272 |