[(1S,2R,4S,5R,6S,8E,10S,12R,14R,15R)-5,6,15-triacetyloxy-12,14-dihydroxy-7,7,10,14-tetramethyl-3-methylidene-11,16-dioxo-4-phenoxy-2-bicyclo[10.3.1]hexadec-8-enyl] 2-methylpropanoate
| Internal ID | 24ad0b36-016d-46be-995f-010b899e993c |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Tetracarboxylic acids and derivatives |
| IUPAC Name | [(1S,2R,4S,5R,6S,8E,10S,12R,14R,15R)-5,6,15-triacetyloxy-12,14-dihydroxy-7,7,10,14-tetramethyl-3-methylidene-11,16-dioxo-4-phenoxy-2-bicyclo[10.3.1]hexadec-8-enyl] 2-methylpropanoate |
| SMILES (Canonical) | CC1C=CC(C(C(C(C(=C)C(C2C(C(CC(C1=O)(C2=O)O)(C)O)OC(=O)C)OC(=O)C(C)C)OC3=CC=CC=C3)OC(=O)C)OC(=O)C)(C)C |
| SMILES (Isomeric) | C[C@H]1/C=C/C([C@@H]([C@@H]([C@H](C(=C)[C@@H]([C@H]2[C@H]([C@](C[C@@](C1=O)(C2=O)O)(C)O)OC(=O)C)OC(=O)C(C)C)OC3=CC=CC=C3)OC(=O)C)OC(=O)C)(C)C |
| InChI | InChI=1S/C37H48O13/c1-19(2)34(43)50-27-21(4)28(49-25-14-12-11-13-15-25)29(46-22(5)38)33(48-24(7)40)35(8,9)17-16-20(3)30(41)37(45)18-36(10,44)32(47-23(6)39)26(27)31(37)42/h11-17,19-20,26-29,32-33,44-45H,4,18H2,1-3,5-10H3/b17-16+/t20-,26+,27-,28-,29+,32+,33+,36+,37+/m0/s1 |
| InChI Key | FQRAIJFUXNSOIX-GSEVOAJDSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C37H48O13 |
| Molecular Weight | 700.80 g/mol |
| Exact Mass | 700.30949158 g/mol |
| Topological Polar Surface Area (TPSA) | 189.00 Ų |
| XlogP | 3.80 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.32% | 91.11% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 97.22% | 90.17% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.87% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.27% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.01% | 98.95% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 92.79% | 91.19% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.35% | 86.33% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 90.04% | 96.47% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 89.95% | 99.23% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 88.98% | 95.50% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.08% | 94.45% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 86.77% | 94.62% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.80% | 89.00% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 84.67% | 94.75% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 84.67% | 82.69% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 82.97% | 97.25% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 82.57% | 90.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.29% | 95.89% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 81.78% | 95.71% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.68% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Euphorbia dendroides |
| PubChem | 163193107 |
| LOTUS | LTS0175329 |
| wikiData | Q104999809 |