[(2R,3S,4S,5R,6S)-6-[(2S,3R,4R,5R,6S)-4,5-dihydroxy-2-[4-[(2S,11R)-11-hydroxy-9-[(2S)-2-methylbutanoyl]-4-oxo-1,5,9-triazacyclotridec-2-yl]phenoxy]-6-methyloxan-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl (2S)-2-methylbutanoate
Internal ID | 4ab41bf0-723f-4d59-b729-9ff10b305371 |
Taxonomy | Lipids and lipid-like molecules > Saccharolipids |
IUPAC Name | [(2R,3S,4S,5R,6S)-6-[(2S,3R,4R,5R,6S)-4,5-dihydroxy-2-[4-[(2S,11R)-11-hydroxy-9-[(2S)-2-methylbutanoyl]-4-oxo-1,5,9-triazacyclotridec-2-yl]phenoxy]-6-methyloxan-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl (2S)-2-methylbutanoate |
SMILES (Canonical) | CCC(C)C(=O)N1CCCNC(=O)CC(NCCC(C1)O)C2=CC=C(C=C2)OC3C(C(C(C(O3)C)O)O)OC4C(C(C(C(O4)COC(=O)C(C)CC)O)O)O |
SMILES (Isomeric) | CC[C@H](C)C(=O)N1CCCNC(=O)C[C@H](NCC[C@H](C1)O)C2=CC=C(C=C2)O[C@H]3[C@@H]([C@@H]([C@H]([C@@H](O3)C)O)O)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)COC(=O)[C@@H](C)CC)O)O)O |
InChI | InChI=1S/C38H61N3O14/c1-6-20(3)35(49)41-16-8-14-40-28(43)17-26(39-15-13-24(42)18-41)23-9-11-25(12-10-23)53-38-34(32(47)29(44)22(5)52-38)55-37-33(48)31(46)30(45)27(54-37)19-51-36(50)21(4)7-2/h9-12,20-22,24,26-27,29-34,37-39,42,44-48H,6-8,13-19H2,1-5H3,(H,40,43)/t20-,21-,22-,24+,26-,27+,29-,30+,31-,32+,33+,34+,37-,38-/m0/s1 |
InChI Key | LAKJMQZPQITUGL-CDIKTVDDSA-N |
Popularity | 0 references in papers |
Molecular Formula | C38H61N3O14 |
Molecular Weight | 783.90 g/mol |
Exact Mass | 783.41535363 g/mol |
Topological Polar Surface Area (TPSA) | 246.00 Ų |
XlogP | -0.50 |
There are no found synonyms. |
![2D Structure of [(2R,3S,4S,5R,6S)-6-[(2S,3R,4R,5R,6S)-4,5-dihydroxy-2-[4-[(2S,11R)-11-hydroxy-9-[(2S)-2-methylbutanoyl]-4-oxo-1,5,9-triazacyclotridec-2-yl]phenoxy]-6-methyloxan-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl (2S)-2-methylbutanoate 2D Structure of [(2R,3S,4S,5R,6S)-6-[(2S,3R,4R,5R,6S)-4,5-dihydroxy-2-[4-[(2S,11R)-11-hydroxy-9-[(2S)-2-methylbutanoyl]-4-oxo-1,5,9-triazacyclotridec-2-yl]phenoxy]-6-methyloxan-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl (2S)-2-methylbutanoate](https://plantaedb.com/storage/docs/compounds/2023/11/dbf25840-85f2-11ee-bf5f-8195ae42d7f3.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 99.45% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.91% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 98.37% | 97.09% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 97.67% | 83.57% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 96.18% | 95.89% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.91% | 97.25% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.00% | 91.11% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 94.88% | 95.93% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.34% | 89.00% |
CHEMBL220 | P22303 | Acetylcholinesterase | 93.21% | 94.45% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 92.27% | 96.61% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 89.95% | 90.71% |
CHEMBL4208 | P20618 | Proteasome component C5 | 89.88% | 90.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.86% | 94.00% |
CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 88.23% | 96.31% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 87.80% | 93.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.22% | 86.33% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 86.27% | 90.08% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.22% | 99.23% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 84.72% | 94.80% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 83.90% | 100.00% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 82.93% | 92.50% |
CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 82.91% | 96.25% |
CHEMBL202 | P00374 | Dihydrofolate reductase | 82.86% | 89.92% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 82.85% | 97.36% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 82.41% | 95.83% |
CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 81.82% | 98.33% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.55% | 94.33% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 81.35% | 95.58% |
CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR | 80.64% | 92.78% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.32% | 95.56% |
CHEMBL255 | P29275 | Adenosine A2b receptor | 80.24% | 98.59% |
CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 80.24% | 86.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Meehania urticifolia |
PubChem | 44179262 |
LOTUS | LTS0122920 |
wikiData | Q105148704 |