[(1S,2S,7R,10R,11R,12R)-4-hydroxy-1,5-dimethyl-9-oxo-8-oxatetracyclo[8.3.1.02,6.07,11]tetradec-5-en-12-yl] 2-methylprop-2-enoate
Internal ID | 15cffbe5-183e-478b-8b81-3d83f460afcc |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones |
IUPAC Name | [(1S,2S,7R,10R,11R,12R)-4-hydroxy-1,5-dimethyl-9-oxo-8-oxatetracyclo[8.3.1.02,6.07,11]tetradec-5-en-12-yl] 2-methylprop-2-enoate |
SMILES (Canonical) | CC1=C2C(CC1O)C3(CC4C(C2OC4=O)C(C3)OC(=O)C(=C)C)C |
SMILES (Isomeric) | CC1=C2[C@@H](CC1O)[C@]3(C[C@@H]4[C@@H]([C@H]2OC4=O)[C@@H](C3)OC(=O)C(=C)C)C |
InChI | InChI=1S/C19H24O5/c1-8(2)17(21)23-13-7-19(4)6-10-15(13)16(24-18(10)22)14-9(3)12(20)5-11(14)19/h10-13,15-16,20H,1,5-7H2,2-4H3/t10-,11-,12?,13-,15-,16+,19+/m1/s1 |
InChI Key | NYFZEWICSQORLI-RCXMVJKKSA-N |
Popularity | 0 references in papers |
Molecular Formula | C19H24O5 |
Molecular Weight | 332.40 g/mol |
Exact Mass | 332.16237386 g/mol |
Topological Polar Surface Area (TPSA) | 72.80 Ų |
XlogP | 1.40 |
There are no found synonyms. |
![2D Structure of [(1S,2S,7R,10R,11R,12R)-4-hydroxy-1,5-dimethyl-9-oxo-8-oxatetracyclo[8.3.1.02,6.07,11]tetradec-5-en-12-yl] 2-methylprop-2-enoate 2D Structure of [(1S,2S,7R,10R,11R,12R)-4-hydroxy-1,5-dimethyl-9-oxo-8-oxatetracyclo[8.3.1.02,6.07,11]tetradec-5-en-12-yl] 2-methylprop-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/db376340-85eb-11ee-abbc-8f56de70a4c2.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.52% | 91.11% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 94.99% | 96.95% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 93.74% | 91.49% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.78% | 94.45% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.32% | 85.14% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.34% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.94% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.00% | 97.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 87.17% | 97.25% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 86.08% | 91.19% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 85.83% | 95.50% |
CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 85.55% | 90.93% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.35% | 99.23% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.04% | 89.00% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.65% | 97.14% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 80.38% | 97.21% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.15% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Artemisia pontica |
PubChem | 101688818 |
LOTUS | LTS0120457 |
wikiData | Q105187492 |