3-[(3S,9S,12S,15S,18S,20R,24S,26Z,30S,33S)-27-[(2S)-2-[[(2S)-1-[[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamoyl]pyrrolidine-1-carbonyl]-12,24-bis[(2S)-butan-2-yl]-20-hydroxy-30-(2-methylpropyl)-2,8,11,14,17,23,29,32-octaoxo-9-propan-2-yl-1,7,10,13,16,22,25,28,31-nonazatetracyclo[31.3.0.03,7.018,22]hexatriacont-26-en-15-yl]propanoic acid
| Internal ID | 7aa27498-bb0d-4240-99f1-aa9b4c748b34 |
| Taxonomy | Organic Polymers > Polypeptides |
| IUPAC Name | 3-[(3S,9S,12S,15S,18S,20R,24S,26Z,30S,33S)-27-[(2S)-2-[[(2S)-1-[[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamoyl]pyrrolidine-1-carbonyl]-12,24-bis[(2S)-butan-2-yl]-20-hydroxy-30-(2-methylpropyl)-2,8,11,14,17,23,29,32-octaoxo-9-propan-2-yl-1,7,10,13,16,22,25,28,31-nonazatetracyclo[31.3.0.03,7.018,22]hexatriacont-26-en-15-yl]propanoic acid |
| SMILES (Canonical) | CCC(C)C1C(=O)NC(C(=O)N2CCCC2C(=O)N3CCCC3C(=O)NC(C(=O)NC(=CNC(C(=O)N4CC(CC4C(=O)NC(C(=O)N1)CCC(=O)O)O)C(C)CC)C(=O)N5CCCC5C(=O)NC(CC(C)C)C(=O)NC(CC6=CC=CC=C6)C(=O)N)CC(C)C)C(C)C |
| SMILES (Isomeric) | CC[C@H](C)[C@H]1C(=O)N[C@H](C(=O)N2CCC[C@H]2C(=O)N3CCC[C@H]3C(=O)N[C@H](C(=O)N/C(=C\N[C@H](C(=O)N4C[C@@H](C[C@H]4C(=O)N[C@H](C(=O)N1)CCC(=O)O)O)[C@@H](C)CC)/C(=O)N5CCC[C@H]5C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC6=CC=CC=C6)C(=O)N)CC(C)C)C(C)C |
| InChI | InChI=1S/C66H101N13O15/c1-11-38(9)53-62(90)74-52(37(7)8)65(93)78-28-18-23-49(78)64(92)77-27-17-22-48(77)60(88)72-45(30-36(5)6)58(86)73-46(33-68-54(39(10)12-2)66(94)79-34-41(80)32-50(79)61(89)69-42(56(84)75-53)24-25-51(81)82)63(91)76-26-16-21-47(76)59(87)71-44(29-35(3)4)57(85)70-43(55(67)83)31-40-19-14-13-15-20-40/h13-15,19-20,33,35-39,41-45,47-50,52-54,68,80H,11-12,16-18,21-32,34H2,1-10H3,(H2,67,83)(H,69,89)(H,70,85)(H,71,87)(H,72,88)(H,73,86)(H,74,90)(H,75,84)(H,81,82)/b46-33-/t38-,39-,41+,42-,43-,44-,45-,47-,48-,49-,50-,52-,53-,54-/m0/s1 |
| InChI Key | WSNONXGZAQRQBF-ZYXJJOLVSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C66H101N13O15 |
| Molecular Weight | 1316.60 g/mol |
| Exact Mass | 1315.75400957 g/mol |
| Topological Polar Surface Area (TPSA) | 398.00 Ų |
| XlogP | 4.00 |
| Atomic LogP (AlogP) | 0.19 |
| H-Bond Acceptor | 15 |
| H-Bond Donor | 11 |
| Rotatable Bonds | 20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.8522 | 85.22% |
| Caco-2 | - | 0.8636 | 86.36% |
| Blood Brain Barrier | - | 0.8000 | 80.00% |
| Human oral bioavailability | - | 0.7143 | 71.43% |
| Subcellular localzation | Mitochondria | 0.6865 | 68.65% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8235 | 82.35% |
| OATP1B3 inhibitior | + | 0.9255 | 92.55% |
| MATE1 inhibitior | - | 0.9046 | 90.46% |
| OCT2 inhibitior | - | 0.9250 | 92.50% |
| BSEP inhibitior | + | 0.9595 | 95.95% |
| P-glycoprotein inhibitior | + | 0.7425 | 74.25% |
| P-glycoprotein substrate | + | 0.8873 | 88.73% |
| CYP3A4 substrate | + | 0.7497 | 74.97% |
| CYP2C9 substrate | - | 0.8026 | 80.26% |
| CYP2D6 substrate | - | 0.8407 | 84.07% |
| CYP3A4 inhibition | - | 0.8563 | 85.63% |
| CYP2C9 inhibition | - | 0.8718 | 87.18% |
| CYP2C19 inhibition | - | 0.8070 | 80.70% |
| CYP2D6 inhibition | - | 0.9341 | 93.41% |
| CYP1A2 inhibition | - | 0.8848 | 88.48% |
| CYP2C8 inhibition | + | 0.7810 | 78.10% |
| CYP inhibitory promiscuity | - | 0.9545 | 95.45% |
| UGT catelyzed | + | 0.6000 | 60.00% |
| Carcinogenicity (binary) | - | 0.8400 | 84.00% |
| Carcinogenicity (trinary) | Non-required | 0.5610 | 56.10% |
| Eye corrosion | - | 0.9894 | 98.94% |
| Eye irritation | - | 0.8965 | 89.65% |
| Skin irritation | - | 0.7771 | 77.71% |
| Skin corrosion | - | 0.9205 | 92.05% |
| Ames mutagenesis | - | 0.7364 | 73.64% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.3627 | 36.27% |
| Micronuclear | + | 0.8400 | 84.00% |
| Hepatotoxicity | + | 0.6392 | 63.92% |
| skin sensitisation | - | 0.8748 | 87.48% |
| Respiratory toxicity | + | 0.7889 | 78.89% |
| Reproductive toxicity | + | 0.9556 | 95.56% |
| Mitochondrial toxicity | + | 0.8500 | 85.00% |
| Nephrotoxicity | - | 0.6929 | 69.29% |
| Acute Oral Toxicity (c) | III | 0.5645 | 56.45% |
| Estrogen receptor binding | + | 0.6692 | 66.92% |
| Androgen receptor binding | + | 0.7495 | 74.95% |
| Thyroid receptor binding | + | 0.6413 | 64.13% |
| Glucocorticoid receptor binding | + | 0.7807 | 78.07% |
| Aromatase binding | + | 0.7307 | 73.07% |
| PPAR gamma | + | 0.8149 | 81.49% |
| Honey bee toxicity | - | 0.6642 | 66.42% |
| Biodegradation | - | 0.8250 | 82.50% |
| Crustacea aquatic toxicity | - | 0.5500 | 55.00% |
| Fish aquatic toxicity | + | 0.9375 | 93.75% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.98% | 98.95% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 99.95% | 90.17% |
| CHEMBL3837 | P07711 | Cathepsin L | 99.87% | 96.61% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 99.61% | 97.64% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.09% | 96.09% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 98.76% | 91.81% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 98.25% | 98.33% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 97.83% | 97.14% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 97.14% | 82.69% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.71% | 97.09% |
| CHEMBL4462 | Q8IXJ6 | NAD-dependent deacetylase sirtuin 2 | 95.36% | 90.24% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 95.17% | 93.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.06% | 95.56% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 94.62% | 89.63% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 94.62% | 90.08% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 94.61% | 93.56% |
| CHEMBL4198 | P98170 | Inhibitor of apoptosis protein 3 | 94.54% | 97.79% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 94.05% | 96.03% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.92% | 94.45% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 93.74% | 82.38% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 93.63% | 95.00% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 93.21% | 90.71% |
| CHEMBL1801 | P00747 | Plasminogen | 92.87% | 92.44% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 92.77% | 96.47% |
| CHEMBL4801 | P29466 | Caspase-1 | 92.67% | 96.85% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 92.65% | 100.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.55% | 91.11% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 91.66% | 100.00% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 91.30% | 93.03% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 91.13% | 95.89% |
| CHEMBL3024 | P53350 | Serine/threonine-protein kinase PLK1 | 89.98% | 97.43% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 89.53% | 98.24% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 89.50% | 94.66% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 89.37% | 91.19% |
| CHEMBL5939 | Q9NZ08 | Endoplasmic reticulum aminopeptidase 1 | 89.29% | 100.00% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 88.75% | 88.56% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 88.60% | 97.25% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.25% | 99.17% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 87.84% | 90.20% |
| CHEMBL4071 | P08311 | Cathepsin G | 86.49% | 94.64% |
| CHEMBL228 | P31645 | Serotonin transporter | 86.36% | 95.51% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 86.00% | 96.11% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 85.20% | 100.00% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 84.87% | 98.10% |
| CHEMBL4123 | P30989 | Neurotensin receptor 1 | 84.78% | 96.67% |
| CHEMBL1944495 | P28065 | Proteasome subunit beta type-9 | 84.28% | 97.50% |
| CHEMBL4777 | P25929 | Neuropeptide Y receptor type 1 | 84.24% | 96.67% |
| CHEMBL3729 | P22748 | Carbonic anhydrase IV | 82.82% | 99.23% |
| CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 82.70% | 96.31% |
| CHEMBL4018 | P49146 | Neuropeptide Y receptor type 2 | 82.20% | 98.94% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 81.66% | 96.90% |
| CHEMBL274 | P51681 | C-C chemokine receptor type 5 | 81.43% | 98.77% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.73% | 99.23% |
| CHEMBL5028 | O14672 | ADAM10 | 80.57% | 97.50% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.20% | 95.89% |
| CHEMBL4461 | Q9NTG7 | NAD-dependent deacetylase sirtuin 3 | 80.02% | 94.36% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 122183785 |
| LOTUS | LTS0185944 |
| wikiData | Q105311983 |