Davanone D
Internal ID | 3803fbed-7cc6-47c5-b685-e585c00988d6 |
Taxonomy | Organoheterocyclic compounds > Tetrahydrofurans |
IUPAC Name | (2S)-2-[(2S,5R)-5-ethenyl-5-methyloxolan-2-yl]-6-methylhept-5-en-3-one |
SMILES (Canonical) | CC(C1CCC(O1)(C)C=C)C(=O)CC=C(C)C |
SMILES (Isomeric) | C[C@@H]([C@@H]1CC[C@](O1)(C)C=C)C(=O)CC=C(C)C |
InChI | InChI=1S/C15H24O2/c1-6-15(5)10-9-14(17-15)12(4)13(16)8-7-11(2)3/h6-7,12,14H,1,8-10H2,2-5H3/t12-,14+,15+/m1/s1 |
InChI Key | FJKKZNIYYVEYOL-SNPRPXQTSA-N |
Popularity | 3 references in papers |
Molecular Formula | C15H24O2 |
Molecular Weight | 236.35 g/mol |
Exact Mass | 236.177630004 g/mol |
Topological Polar Surface Area (TPSA) | 26.30 Ų |
XlogP | 3.30 |
20482-11-5 |
Davadone D |
(+)-Davanone D |
MEGxp0_001579 |
ACon0_000084 |
ACon1_001276 |
DTXSID70174449 |
5-Hepten-3-one, 6-methyl-2-(tetrahydro-5-methyl-5-vinyl-2-furyl)-, (+)- |
NCGC00169508-01 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.86% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.72% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.16% | 94.45% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.28% | 97.25% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 88.40% | 96.61% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 87.08% | 91.19% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 86.16% | 96.47% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 86.10% | 91.24% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 85.13% | 100.00% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 84.95% | 90.17% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.94% | 92.62% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 83.36% | 97.50% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.91% | 100.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.48% | 89.00% |
CHEMBL237 | P41145 | Kappa opioid receptor | 82.46% | 98.10% |
CHEMBL233 | P35372 | Mu opioid receptor | 81.71% | 97.93% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 81.29% | 89.05% |
CHEMBL2581 | P07339 | Cathepsin D | 81.05% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.83% | 97.09% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 80.79% | 96.77% |
CHEMBL236 | P41143 | Delta opioid receptor | 80.78% | 99.35% |
CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 80.35% | 95.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Artemisia abrotanum |
Tanacetum vulgare |
PubChem | 88556 |
LOTUS | LTS0126907 |
wikiData | Q83044529 |