Datumetine
Internal ID | 5eb7b25c-ffcf-4eca-bd3a-537043c2826f |
Taxonomy | Alkaloids and derivatives > Tropane alkaloids > Phenyltropanes |
IUPAC Name | 4-methoxy-3-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)benzoic acid |
SMILES (Canonical) | CN1C2CCC1CC(C2)C3=C(C=CC(=C3)C(=O)O)OC |
SMILES (Isomeric) | CN1C2CCC1CC(C2)C3=C(C=CC(=C3)C(=O)O)OC |
InChI | InChI=1S/C16H21NO3/c1-17-12-4-5-13(17)8-11(7-12)14-9-10(16(18)19)3-6-15(14)20-2/h3,6,9,11-13H,4-5,7-8H2,1-2H3,(H,18,19) |
InChI Key | CMMJWJKGQZIJPB-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C16H21NO3 |
Molecular Weight | 275.34 g/mol |
Exact Mass | 275.15214353 g/mol |
Topological Polar Surface Area (TPSA) | 49.80 Ų |
XlogP | 0.30 |
67078-20-0 |
4-methoxy-3-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)benzoic acid |
DTXSID40986112 |
4-Methoxy-3-(8-methyl-8-azabicyclo(3.2.1)oct-3-yl)benzoic acid |
AKOS040734546 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.37% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.19% | 86.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.30% | 99.17% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.10% | 95.89% |
CHEMBL4208 | P20618 | Proteasome component C5 | 87.86% | 90.00% |
CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 87.81% | 90.24% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 87.59% | 91.19% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 87.23% | 89.62% |
CHEMBL2535 | P11166 | Glucose transporter | 86.16% | 98.75% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.60% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 85.22% | 98.95% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.58% | 95.89% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 82.65% | 97.21% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 81.87% | 93.00% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 81.07% | 90.20% |
CHEMBL1899 | P46098 | Serotonin 3a (5-HT3a) receptor | 80.03% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Datura metel |
PubChem | 181868 |
LOTUS | LTS0009495 |
wikiData | Q82973903 |