[(2R,3R,5R,7R,8S,9S)-2-[(1S,3S,4S,5R,6R,7E,9Z,11E,13E)-14-cyano-3,5-dihydroxy-1-methoxy-4,6,8,9-tetramethyltetradeca-7,9,11,13-tetraenyl]-9-[(E)-3-[2-[(2S)-4-[[(2S,3S,4S)-4-(dimethylamino)-2,3-dihydroxy-5-methoxypentanoyl]amino]butan-2-yl]-1,3-oxazol-4-yl]prop-2-enyl]-7-hydroxy-4,4,8-trimethyl-1,10-dioxaspiro[4.5]decan-3-yl] dihydrogen phosphate
| Internal ID | 6148b92f-11dc-42cc-bf39-2388c87bf638 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Monoterpenoids > Aromatic monoterpenoids |
| IUPAC Name | [(2R,3R,5R,7R,8S,9S)-2-[(1S,3S,4S,5R,6R,7E,9Z,11E,13E)-14-cyano-3,5-dihydroxy-1-methoxy-4,6,8,9-tetramethyltetradeca-7,9,11,13-tetraenyl]-9-[(E)-3-[2-[(2S)-4-[[(2S,3S,4S)-4-(dimethylamino)-2,3-dihydroxy-5-methoxypentanoyl]amino]butan-2-yl]-1,3-oxazol-4-yl]prop-2-enyl]-7-hydroxy-4,4,8-trimethyl-1,10-dioxaspiro[4.5]decan-3-yl] dihydrogen phosphate |
| SMILES (Canonical) | CC1C(CC2(C(C(C(O2)C(CC(C(C)C(C(C)C=C(C)C(=CC=CC=CC#N)C)O)O)OC)OP(=O)(O)O)(C)C)OC1CC=CC3=COC(=N3)C(C)CCNC(=O)C(C(C(COC)N(C)C)O)O)O |
| SMILES (Isomeric) | C[C@H]1[C@@H](C[C@@]2(C([C@H]([C@H](O2)[C@H](C[C@@H]([C@H](C)[C@@H]([C@H](C)/C=C(\C)/C(=C\C=C\C=C\C#N)/C)O)O)OC)OP(=O)(O)O)(C)C)O[C@H]1C/C=C/C3=COC(=N3)[C@@H](C)CCNC(=O)[C@H]([C@H]([C@H](COC)N(C)C)O)O)O |
| InChI | InChI=1S/C49H79N4O15P/c1-29(18-15-13-14-16-22-50)31(3)24-32(4)41(56)34(6)37(54)25-40(64-12)44-45(68-69(60,61)62)48(7,8)49(67-44)26-38(55)33(5)39(66-49)20-17-19-35-27-65-47(52-35)30(2)21-23-51-46(59)43(58)42(57)36(28-63-11)53(9)10/h13-19,24,27,30,32-34,36-45,54-58H,20-21,23,25-26,28H2,1-12H3,(H,51,59)(H2,60,61,62)/b15-13+,16-14+,19-17+,29-18-,31-24+/t30-,32+,33-,34-,36-,37-,38+,39-,40-,41+,42-,43-,44+,45-,49+/m0/s1 |
| InChI Key | NETBPLMLOTXQJJ-HZCONUAJSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C49H79N4O15P |
| Molecular Weight | 995.10 g/mol |
| Exact Mass | 994.52795482 g/mol |
| Topological Polar Surface Area (TPSA) | 287.00 Ų |
| XlogP | 1.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.61% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.54% | 91.11% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 98.07% | 90.17% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 97.06% | 96.38% |
| CHEMBL1914 | P06276 | Butyrylcholinesterase | 96.80% | 95.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.03% | 98.95% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 95.17% | 94.73% |
| CHEMBL3837 | P07711 | Cathepsin L | 93.17% | 96.61% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 92.73% | 100.00% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 91.81% | 95.50% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.49% | 97.25% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 91.45% | 96.00% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 91.18% | 93.56% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 90.63% | 93.10% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.44% | 85.14% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.22% | 89.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.44% | 99.17% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 86.49% | 96.90% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.01% | 99.23% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 85.20% | 95.17% |
| CHEMBL2007625 | O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | 83.51% | 99.00% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 83.38% | 95.58% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.95% | 95.89% |
| CHEMBL5028 | O14672 | ADAM10 | 82.58% | 97.50% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 82.38% | 98.75% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.68% | 86.33% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.88% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163193466 |
| LOTUS | LTS0217370 |
| wikiData | Q105178176 |