2-[(1S,6R)-6-(2,4-dihydroxybenzoyl)-5-(2,4-dihydroxyphenyl)-3-methylcyclohex-2-en-1-yl]-1,3,5a,8-tetrahydroxy-10a-(3-methylbut-2-enyl)-[1]benzofuro[3,2-b]chromen-11-one
Internal ID | e200392f-4a1f-4c0c-8267-1f808a54d115 |
Taxonomy | Phenylpropanoids and polyketides > Diarylheptanoids > Linear diarylheptanoids |
IUPAC Name | 2-[(1S,6R)-6-(2,4-dihydroxybenzoyl)-5-(2,4-dihydroxyphenyl)-3-methylcyclohex-2-en-1-yl]-1,3,5a,8-tetrahydroxy-10a-(3-methylbut-2-enyl)-[1]benzofuro[3,2-b]chromen-11-one |
SMILES (Canonical) | CC1=CC(C(C(C1)C2=C(C=C(C=C2)O)O)C(=O)C3=C(C=C(C=C3)O)O)C4=C(C5=C(C=C4O)OC6(C7=C(C=C(C=C7)O)OC6(C5=O)CC=C(C)C)O)O |
SMILES (Isomeric) | CC1=C[C@@H]([C@@H](C(C1)C2=C(C=C(C=C2)O)O)C(=O)C3=C(C=C(C=C3)O)O)C4=C(C5=C(C=C4O)OC6(C7=C(C=C(C=C7)O)OC6(C5=O)CC=C(C)C)O)O |
InChI | InChI=1S/C40H36O12/c1-18(2)10-11-39-38(49)35-32(52-40(39,50)27-9-6-22(43)16-31(27)51-39)17-30(46)34(37(35)48)26-13-19(3)12-25(23-7-4-20(41)14-28(23)44)33(26)36(47)24-8-5-21(42)15-29(24)45/h4-10,13-17,25-26,33,41-46,48,50H,11-12H2,1-3H3/t25?,26-,33+,39?,40?/m0/s1 |
InChI Key | SUOXGDJCEWTZIZ-BQXUNMGUSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C40H36O12 |
Molecular Weight | 708.70 g/mol |
Exact Mass | 708.22067658 g/mol |
Topological Polar Surface Area (TPSA) | 214.00 Ų |
XlogP | 6.30 |
CHEMBL1588549 |
HMS2268D11 |
SMR000470916 |
![2D Structure of 2-[(1S,6R)-6-(2,4-dihydroxybenzoyl)-5-(2,4-dihydroxyphenyl)-3-methylcyclohex-2-en-1-yl]-1,3,5a,8-tetrahydroxy-10a-(3-methylbut-2-enyl)-[1]benzofuro[3,2-b]chromen-11-one 2D Structure of 2-[(1S,6R)-6-(2,4-dihydroxybenzoyl)-5-(2,4-dihydroxyphenyl)-3-methylcyclohex-2-en-1-yl]-1,3,5a,8-tetrahydroxy-10a-(3-methylbut-2-enyl)-[1]benzofuro[3,2-b]chromen-11-one](https://plantaedb.com/storage/docs/compounds/2023/07/daa233d0-256d-11ee-b5fb-2f6cc22f11cb.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.78% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 99.30% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.31% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.30% | 85.14% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.95% | 94.45% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.10% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.03% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.82% | 95.56% |
CHEMBL4208 | P20618 | Proteasome component C5 | 92.04% | 90.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 90.41% | 90.71% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.04% | 99.23% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 88.31% | 95.17% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.08% | 97.09% |
CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 87.54% | 90.93% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.42% | 95.89% |
CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 86.61% | 85.11% |
CHEMBL3038469 | P24941 | CDK2/Cyclin A | 86.56% | 91.38% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.07% | 100.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 85.78% | 95.89% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 85.46% | 95.62% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.07% | 94.73% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 84.63% | 85.00% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 81.59% | 91.07% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 80.97% | 91.24% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 80.67% | 93.40% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.66% | 94.00% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 80.58% | 94.42% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 80.15% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Morus alba |
Morus cathayana |
PubChem | 23641096 |
NPASS | NPC17105 |
ChEMBL | CHEMBL1588549 |