[(1S,3R,6S,8S,11R,12S,15R,16R)-15-[(2R,5S)-5-ethyl-6-methylhept-6-en-2-yl]-7,7,12,16-tetramethyl-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl] acetate
Internal ID | 5b8dda20-4126-47c6-a759-28ec44991c4b |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Cycloartanols and derivatives |
IUPAC Name | [(1S,3R,6S,8S,11R,12S,15R,16R)-15-[(2R,5S)-5-ethyl-6-methylhept-6-en-2-yl]-7,7,12,16-tetramethyl-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl] acetate |
SMILES (Canonical) | CCC(CCC(C)C1CCC2(C1(CCC34C2CCC5C3(C4)CCC(C5(C)C)OC(=O)C)C)C)C(=C)C |
SMILES (Isomeric) | CC[C@@H](CC[C@@H](C)[C@H]1CC[C@@]2([C@@]1(CC[C@]34[C@@H]2CC[C@H]5[C@]3(C4)CC[C@@H](C5(C)C)OC(=O)C)C)C)C(=C)C |
InChI | InChI=1S/C34H56O2/c1-10-25(22(2)3)12-11-23(4)26-15-17-32(9)28-14-13-27-30(6,7)29(36-24(5)35)16-18-33(27)21-34(28,33)20-19-31(26,32)8/h23,25-29H,2,10-21H2,1,3-9H3/t23-,25+,26-,27-,28-,29+,31-,32+,33-,34+/m1/s1 |
InChI Key | FKOIYZJFULCGFU-TUFCAKTQSA-N |
Popularity | 0 references in papers |
Molecular Formula | C34H56O2 |
Molecular Weight | 496.80 g/mol |
Exact Mass | 496.42803102 g/mol |
Topological Polar Surface Area (TPSA) | 26.30 Ų |
XlogP | 11.50 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.26% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.43% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.97% | 94.45% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.12% | 91.11% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 89.82% | 91.19% |
CHEMBL233 | P35372 | Mu opioid receptor | 88.30% | 97.93% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 88.06% | 93.00% |
CHEMBL2581 | P07339 | Cathepsin D | 87.52% | 98.95% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 87.20% | 98.75% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 86.98% | 96.95% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 85.79% | 93.56% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 85.74% | 82.69% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 84.76% | 100.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.07% | 97.09% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 83.71% | 82.50% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 83.53% | 100.00% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 83.35% | 89.50% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 83.13% | 96.47% |
CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 83.12% | 95.71% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.77% | 92.62% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 82.25% | 95.17% |
CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 81.67% | 94.78% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.64% | 95.89% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 81.35% | 92.86% |
CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 80.42% | 97.47% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Polypodium fauriei |
PubChem | 163061141 |
LOTUS | LTS0208265 |
wikiData | Q104996712 |