3,5-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-7-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one
Internal ID | a8d43033-69dd-45c9-acc3-d66e77521bc1 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | 3,5-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-7-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one |
SMILES (Canonical) | COC1=C(C=CC(=C1)C2=C(C(=O)C3=C(C=C(C=C3O2)OC4C(C(C(C(O4)CO)O)O)O)O)O)O |
SMILES (Isomeric) | COC1=C(C=CC(=C1)C2=C(C(=O)C3=C(C=C(C=C3O2)O[C@@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)O)O)O |
InChI | InChI=1S/C22H22O12/c1-31-12-4-8(2-3-10(12)24)21-19(29)17(27)15-11(25)5-9(6-13(15)33-21)32-22-20(30)18(28)16(26)14(7-23)34-22/h2-6,14,16,18,20,22-26,28-30H,7H2,1H3/t14-,16-,18+,20-,22+/m1/s1 |
InChI Key | YCUNOXSUHVGZRI-YTVDIXBESA-N |
Popularity | 0 references in papers |
Molecular Formula | C22H22O12 |
Molecular Weight | 478.40 g/mol |
Exact Mass | 478.11112613 g/mol |
Topological Polar Surface Area (TPSA) | 196.00 Ų |
XlogP | 0.70 |
There are no found synonyms. |
![2D Structure of 3,5-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-7-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one 2D Structure of 3,5-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-7-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/d995e9e0-8687-11ee-9c72-db418e1e4589.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.38% | 91.11% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 97.33% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.74% | 89.00% |
CHEMBL2581 | P07339 | Cathepsin D | 95.32% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.92% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.32% | 86.33% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 93.24% | 99.15% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.97% | 99.17% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 90.72% | 86.92% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.27% | 85.14% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 89.69% | 91.49% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.23% | 95.56% |
CHEMBL3401 | O75469 | Pregnane X receptor | 88.87% | 94.73% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.75% | 94.45% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.65% | 95.89% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 85.92% | 95.78% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.40% | 97.09% |
CHEMBL3194 | P02766 | Transthyretin | 85.35% | 90.71% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 84.36% | 95.64% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 84.14% | 96.21% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.87% | 96.00% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 82.12% | 97.36% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.41% | 90.71% |
CHEMBL3438 | Q05513 | Protein kinase C zeta | 80.25% | 88.48% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Artemisia monosperma |
Sedum acre |
PubChem | 162951222 |
LOTUS | LTS0180276 |
wikiData | Q105346505 |