(2S,3S,4aR,6R,7R,8S,8aR)-6-(hydroxymethyl)-2-(4-methoxyphenyl)-3-methyl-3,4a,6,7,8,8a-hexahydro-2H-pyrano[2,3-b][1,4]dioxine-7,8-diol
Internal ID | 46c933c3-b158-4972-b6d9-1ce996f44562 |
Taxonomy | Organoheterocyclic compounds > Pyranodioxins |
IUPAC Name | (2S,3S,4aR,6R,7R,8S,8aR)-6-(hydroxymethyl)-2-(4-methoxyphenyl)-3-methyl-3,4a,6,7,8,8a-hexahydro-2H-pyrano[2,3-b][1,4]dioxine-7,8-diol |
SMILES (Canonical) | CC1C(OC2C(C(C(OC2O1)CO)O)O)C3=CC=C(C=C3)OC |
SMILES (Isomeric) | C[C@H]1[C@@H](O[C@@H]2[C@H]([C@H]([C@H](O[C@H]2O1)CO)O)O)C3=CC=C(C=C3)OC |
InChI | InChI=1S/C16H22O7/c1-8-14(9-3-5-10(20-2)6-4-9)23-15-13(19)12(18)11(7-17)22-16(15)21-8/h3-6,8,11-19H,7H2,1-2H3/t8-,11+,12-,13-,14+,15+,16+/m0/s1 |
InChI Key | USUWYXHMWYBKFQ-RJMWRMBQSA-N |
Popularity | 0 references in papers |
Molecular Formula | C16H22O7 |
Molecular Weight | 326.34 g/mol |
Exact Mass | 326.13655304 g/mol |
Topological Polar Surface Area (TPSA) | 97.60 Ų |
XlogP | 0.20 |
There are no found synonyms. |
![2D Structure of (2S,3S,4aR,6R,7R,8S,8aR)-6-(hydroxymethyl)-2-(4-methoxyphenyl)-3-methyl-3,4a,6,7,8,8a-hexahydro-2H-pyrano[2,3-b][1,4]dioxine-7,8-diol 2D Structure of (2S,3S,4aR,6R,7R,8S,8aR)-6-(hydroxymethyl)-2-(4-methoxyphenyl)-3-methyl-3,4a,6,7,8,8a-hexahydro-2H-pyrano[2,3-b][1,4]dioxine-7,8-diol](https://plantaedb.com/storage/docs/compounds/2023/11/d98bf350-86d1-11ee-8126-a3b3b1622f40.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.60% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.29% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.06% | 97.09% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 90.47% | 95.93% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 88.98% | 86.92% |
CHEMBL4208 | P20618 | Proteasome component C5 | 87.51% | 90.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.82% | 94.73% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.12% | 86.33% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.70% | 96.00% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 85.32% | 90.17% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.26% | 95.56% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.67% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 83.61% | 98.95% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.31% | 99.17% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 81.55% | 91.49% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Illicium parvifolium subsp. oligandrum |
PubChem | 163040199 |
LOTUS | LTS0111364 |
wikiData | Q105278521 |