[(1S,8S,9S,10S,13R)-6,9,10-trimethyl-4,14-dioxatetracyclo[7.5.0.01,13.03,7]tetradeca-3(7),5-dien-8-yl] 2-methylpropanoate
| Internal ID | d58a0125-613f-4941-afbf-2a8315faf8de |
| Taxonomy | Organoheterocyclic compounds > Naphthofurans |
| IUPAC Name | [(1S,8S,9S,10S,13R)-6,9,10-trimethyl-4,14-dioxatetracyclo[7.5.0.01,13.03,7]tetradeca-3(7),5-dien-8-yl] 2-methylpropanoate |
| SMILES (Canonical) | CC1CCC2C3(C1(C(C4=C(C3)OC=C4C)OC(=O)C(C)C)C)O2 |
| SMILES (Isomeric) | C[C@H]1CC[C@@H]2[C@]3([C@@]1([C@@H](C4=C(C3)OC=C4C)OC(=O)C(C)C)C)O2 |
| InChI | InChI=1S/C19H26O4/c1-10(2)17(20)22-16-15-11(3)9-21-13(15)8-19-14(23-19)7-6-12(4)18(16,19)5/h9-10,12,14,16H,6-8H2,1-5H3/t12-,14+,16+,18-,19+/m0/s1 |
| InChI Key | NJWDYBRBMQFCFK-WLWWONNKSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.18310931 g/mol |
| Topological Polar Surface Area (TPSA) | 52.00 Ų |
| XlogP | 3.70 |
| There are no found synonyms. |
![2D Structure of [(1S,8S,9S,10S,13R)-6,9,10-trimethyl-4,14-dioxatetracyclo[7.5.0.01,13.03,7]tetradeca-3(7),5-dien-8-yl] 2-methylpropanoate](https://plantaedb.com/storage/docs/compounds/2023/11/d9452db0-8619-11ee-8798-1fb6e21b3391.jpg "2D Structure of [(1S,8S,9S,10S,13R)-6,9,10-trimethyl-4,14-dioxatetracyclo[7.5.0.01,13.03,7]tetradeca-3(7),5-dien-8-yl] 2-methylpropanoate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.26% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.09% | 96.09% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.41% | 97.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.97% | 95.56% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.89% | 94.45% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.48% | 89.00% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 85.34% | 96.21% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 84.53% | 97.25% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 84.04% | 93.56% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.42% | 91.19% |
| CHEMBL3975 | P09467 | Fructose-1,6-bisphosphatase | 83.22% | 92.95% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 82.42% | 94.73% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 81.52% | 92.50% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.45% | 92.62% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 81.10% | 96.47% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Ligularia cyathiceps |
| Pittocaulon praecox |
| PubChem | 14830755 |
| LOTUS | LTS0205276 |
| wikiData | Q105180343 |