2-[9-(3-aminopropyl)-31-[(5-hydroxy-1H-indol-3-yl)methyl]-6-(1H-imidazol-4-ylmethyl)-25-(1H-indol-3-ylmethyl)-3,19-diisopropyl-13-(10-methylundecyl)-2,5,8,11,15,18,21,24,27,30,33,36,39-tridecaoxo-34-(3-ureidopropyl)-14-oxa-1,4,7,10,17,20,23,26,29,32,35,38-dodecazabicyclo[38.3.0]tritetracontan-16-yl]acetic acid
| Internal ID | e7a3d666-7f60-49cc-89ff-7e73e9d8ab79 |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Depsipeptides > Cyclic depsipeptides |
| IUPAC Name | 2-[9-(3-aminopropyl)-34-[3-(carbamoylamino)propyl]-31-[(5-hydroxy-1H-indol-3-yl)methyl]-6-(1H-imidazol-5-ylmethyl)-25-(1H-indol-3-ylmethyl)-13-(10-methylundecyl)-2,5,8,11,15,18,21,24,27,30,33,36,39-tridecaoxo-3,19-di(propan-2-yl)-14-oxa-1,4,7,10,17,20,23,26,29,32,35,38-dodecazabicyclo[38.3.0]tritetracontan-16-yl]acetic acid |
| SMILES (Canonical) | CC(C)CCCCCCCCCC1CC(=O)NC(C(=O)NC(C(=O)NC(C(=O)N2CCCC2C(=O)NCC(=O)NC(C(=O)NC(C(=O)NCC(=O)NC(C(=O)NCC(=O)NC(C(=O)NC(C(=O)O1)CC(=O)O)C(C)C)CC3=CNC4=CC=CC=C43)CC5=CNC6=C5C=C(C=C6)O)CCCNC(=O)N)C(C)C)CC7=CN=CN7)CCCN |
| SMILES (Isomeric) | CC(C)CCCCCCCCCC1CC(=O)NC(C(=O)NC(C(=O)NC(C(=O)N2CCCC2C(=O)NCC(=O)NC(C(=O)NC(C(=O)NCC(=O)NC(C(=O)NCC(=O)NC(C(=O)NC(C(=O)O1)CC(=O)O)C(C)C)CC3=CNC4=CC=CC=C43)CC5=CNC6=C5C=C(C=C6)O)CCCNC(=O)N)C(C)C)CC7=CN=CN7)CCCN |
| InChI | InChI=1S/C79H115N19O18/c1-44(2)19-12-10-8-7-9-11-13-20-51-35-63(100)90-56(23-16-28-80)72(108)94-60(33-49-39-82-43-89-49)74(110)97-69(46(5)6)77(113)98-30-18-25-62(98)75(111)88-41-64(101)91-57(24-17-29-83-79(81)115)73(109)93-59(32-48-38-85-55-27-26-50(99)34-53(48)55)71(107)86-40-65(102)92-58(31-47-37-84-54-22-15-14-21-52(47)54)70(106)87-42-66(103)96-68(45(3)4)76(112)95-61(36-67(104)105)78(114)116-51/h14-15,21-22,26-27,34,37-39,43-46,51,56-62,68-69,84-85,99H,7-13,16-20,23-25,28-33,35-36,40-42,80H2,1-6H3,(H,82,89)(H,86,107)(H,87,106)(H,88,111)(H,90,100)(H,91,101)(H,92,102)(H,93,109)(H,94,108)(H,95,112)(H,96,103)(H,97,110)(H,104,105)(H3,81,83,115) |
| InChI Key | JHVZOPAAIYXZCE-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C79H115N19O18 |
| Molecular Weight | 1618.90 g/mol |
| Exact Mass | 1617.86674790 g/mol |
| Topological Polar Surface Area (TPSA) | 566.00 Ų |
| XlogP | 1.90 |
| Atomic LogP (AlogP) | 0.78 |
| H-Bond Acceptor | 19 |
| H-Bond Donor | 19 |
| Rotatable Bonds | 27 |
| AS-2041835 |
| 2-[9-(3-aminopropyl)-31-[(5-hydroxy-1H-indol-3-yl)methyl]-6-(1H-imidazol-4-ylmethyl)-25-(1H-indol-3-ylmethyl)-3,19-diisopropyl-13-(10-methylundecyl)-2,5,8,11,15,18,21,24,27,30,33,36,39-tridecaoxo-34-(3-ureidopropyl)-14-oxa-1,4,7,10,17,20,23,26,29,32,35,38-dodecazabicyclo[38.3.0]tritetracontan-16-yl]acetic acid |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.9103 | 91.03% |
| Caco-2 | - | 0.8646 | 86.46% |
| Blood Brain Barrier | - | 0.9250 | 92.50% |
| Human oral bioavailability | - | 0.5714 | 57.14% |
| Subcellular localzation | Lysosomes | 0.4503 | 45.03% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8217 | 82.17% |
| OATP1B3 inhibitior | + | 0.9350 | 93.50% |
| MATE1 inhibitior | - | 0.8600 | 86.00% |
| OCT2 inhibitior | - | 0.7250 | 72.50% |
| BSEP inhibitior | + | 0.9807 | 98.07% |
| P-glycoprotein inhibitior | + | 0.7420 | 74.20% |
| P-glycoprotein substrate | + | 0.8923 | 89.23% |
| CYP3A4 substrate | + | 0.7508 | 75.08% |
| CYP2C9 substrate | - | 1.0000 | 100.00% |
| CYP2D6 substrate | - | 0.8263 | 82.63% |
| CYP3A4 inhibition | - | 0.5558 | 55.58% |
| CYP2C9 inhibition | - | 0.7948 | 79.48% |
| CYP2C19 inhibition | - | 0.7282 | 72.82% |
| CYP2D6 inhibition | - | 0.9079 | 90.79% |
| CYP1A2 inhibition | - | 0.8930 | 89.30% |
| CYP2C8 inhibition | + | 0.8423 | 84.23% |
| CYP inhibitory promiscuity | - | 0.7261 | 72.61% |
| UGT catelyzed | + | 0.6000 | 60.00% |
| Carcinogenicity (binary) | - | 0.9300 | 93.00% |
| Carcinogenicity (trinary) | Non-required | 0.5882 | 58.82% |
| Eye corrosion | - | 0.9869 | 98.69% |
| Eye irritation | - | 0.8954 | 89.54% |
| Skin irritation | - | 0.7915 | 79.15% |
| Skin corrosion | - | 0.9349 | 93.49% |
| Ames mutagenesis | - | 0.6654 | 66.54% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.7345 | 73.45% |
| Micronuclear | + | 0.8100 | 81.00% |
| Hepatotoxicity | - | 0.6625 | 66.25% |
| skin sensitisation | - | 0.8765 | 87.65% |
| Respiratory toxicity | + | 0.8556 | 85.56% |
| Reproductive toxicity | + | 0.9444 | 94.44% |
| Mitochondrial toxicity | + | 0.8875 | 88.75% |
| Nephrotoxicity | - | 0.6832 | 68.32% |
| Acute Oral Toxicity (c) | III | 0.5564 | 55.64% |
| Estrogen receptor binding | - | 0.5000 | 50.00% |
| Androgen receptor binding | + | 0.7133 | 71.33% |
| Thyroid receptor binding | + | 0.7877 | 78.77% |
| Glucocorticoid receptor binding | + | 0.8220 | 82.20% |
| Aromatase binding | + | 0.8029 | 80.29% |
| PPAR gamma | + | 0.7431 | 74.31% |
| Honey bee toxicity | - | 0.6602 | 66.02% |
| Biodegradation | - | 0.8500 | 85.00% |
| Crustacea aquatic toxicity | + | 0.5700 | 57.00% |
| Fish aquatic toxicity | + | 0.9129 | 91.29% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.89% | 91.11% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 99.85% | 85.14% |
| CHEMBL2581 | P07339 | Cathepsin D | 99.66% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.59% | 96.09% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 99.24% | 92.97% |
| CHEMBL3038469 | P24941 | CDK2/Cyclin A | 97.83% | 91.38% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 97.44% | 90.08% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 97.05% | 88.56% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 97.01% | 97.64% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.46% | 94.45% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 96.14% | 94.45% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.42% | 95.56% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 94.48% | 82.38% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 93.73% | 99.23% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 93.50% | 94.75% |
| CHEMBL1914 | P06276 | Butyrylcholinesterase | 93.48% | 95.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 92.50% | 98.75% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 92.18% | 95.89% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 91.84% | 83.10% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.40% | 97.09% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 90.61% | 98.59% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 90.34% | 95.62% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 90.29% | 96.90% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 90.22% | 90.20% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 90.11% | 83.82% |
| CHEMBL3155 | P34969 | Serotonin 7 (5-HT7) receptor | 89.87% | 90.71% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.86% | 99.17% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 89.67% | 99.15% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 89.56% | 96.11% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 87.98% | 94.73% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.88% | 89.00% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 87.48% | 95.56% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 87.42% | 95.50% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 87.34% | 91.71% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 86.71% | 98.33% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 85.77% | 95.83% |
| CHEMBL3384 | Q16512 | Protein kinase N1 | 84.95% | 80.71% |
| CHEMBL2096618 | P11274 | Bcr/Abl fusion protein | 84.90% | 85.83% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 84.45% | 95.00% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 84.40% | 93.18% |
| CHEMBL5896 | O75164 | Lysine-specific demethylase 4A | 84.37% | 99.09% |
| CHEMBL4101 | P17612 | cAMP-dependent protein kinase alpha-catalytic subunit | 83.90% | 82.86% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.48% | 86.33% |
| CHEMBL4071 | P08311 | Cathepsin G | 82.91% | 94.64% |
| CHEMBL4302 | P08183 | P-glycoprotein 1 | 82.73% | 92.98% |
| CHEMBL2443 | P49862 | Kallikrein 7 | 82.44% | 94.00% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.37% | 90.71% |
| CHEMBL4530 | P00488 | Coagulation factor XIII | 82.11% | 96.00% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 81.86% | 89.63% |
| CHEMBL4462 | Q8IXJ6 | NAD-dependent deacetylase sirtuin 2 | 80.80% | 90.24% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 46902076 |
| LOTUS | LTS0193212 |
| wikiData | Q104169549 |