6',11-Dihydroxy-10-methoxyspiro[5-azatricyclo[6.3.1.04,12]dodeca-1(12),4,6,8,10-pentaene-2,3'-cyclohexene]-3-one
| Internal ID | bc595815-665b-4907-a865-b9e6519ffa54 |
| Taxonomy | Organoheterocyclic compounds > Isoquinolines and derivatives |
| IUPAC Name | 6',11-dihydroxy-10-methoxyspiro[5-azatricyclo[6.3.1.04,12]dodeca-1(12),4,6,8,10-pentaene-2,3'-cyclohexene]-3-one |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C17H15NO4/c1-22-11-8-9-4-7-18-14-12(9)13(15(11)20)17(16(14)21)5-2-10(19)3-6-17/h2,4-5,7-8,10,19-20H,3,6H2,1H3 |
| InChI Key | LMAOXCUNCMIBNG-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C17H15NO4 |
| Molecular Weight | 297.30 g/mol |
| Exact Mass | 297.10010796 g/mol |
| Topological Polar Surface Area (TPSA) | 79.70 Ų |
| XlogP | 1.80 |
| There are no found synonyms. |
![2D Structure of 6',11-Dihydroxy-10-methoxyspiro[5-azatricyclo[6.3.1.04,12]dodeca-1(12),4,6,8,10-pentaene-2,3'-cyclohexene]-3-one](https://plantaedb.com/storage/docs/compounds/2023/11/d91ab400-83f5-11ee-8ff0-0dba96a5dd44.jpg "2D Structure of 6',11-Dihydroxy-10-methoxyspiro[5-azatricyclo[6.3.1.04,12]dodeca-1(12),4,6,8,10-pentaene-2,3'-cyclohexene]-3-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.33% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.87% | 96.09% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 96.66% | 94.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.29% | 85.14% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 94.13% | 91.49% |
| CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 93.74% | 94.03% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 91.38% | 94.75% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.84% | 89.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.46% | 86.33% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 88.91% | 94.42% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.06% | 99.23% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.66% | 98.95% |
| CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 87.10% | 96.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.96% | 95.89% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.69% | 99.15% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 86.12% | 92.94% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 85.11% | 92.62% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 84.84% | 91.03% |
| CHEMBL2243 | O00519 | Anandamide amidohydrolase | 84.76% | 97.53% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.68% | 97.09% |
| CHEMBL1907598 | P05106 | Integrin alpha-V/beta-3 | 84.13% | 95.71% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.07% | 90.71% |
| CHEMBL2535 | P11166 | Glucose transporter | 82.64% | 98.75% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 82.47% | 100.00% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 81.98% | 95.78% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 81.82% | 97.33% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.39% | 95.56% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 81.01% | 96.67% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 80.88% | 93.10% |
| CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 80.11% | 96.39% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 80.03% | 99.18% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Cryptocarya chinensis |
| PubChem | 85349739 |
| LOTUS | LTS0076058 |
| wikiData | Q105153821 |