[17-Acetyl-8,14,17-trihydroxy-3-[4-hydroxy-5-[5-[5-(5-hydroxy-4-methoxy-6-methyloxan-2-yl)oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-6-methyloxan-2-yl]oxy-10,13-dimethyl-1,2,3,4,5,6,7,9,11,12,15,16-dodecahydrocyclopenta[a]phenanthren-12-yl] benzoate
Internal ID | d56e9eae-271f-435e-a765-8a772a6964d0 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides |
IUPAC Name | [17-acetyl-8,14,17-trihydroxy-3-[4-hydroxy-5-[5-[5-(5-hydroxy-4-methoxy-6-methyloxan-2-yl)oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-6-methyloxan-2-yl]oxy-10,13-dimethyl-1,2,3,4,5,6,7,9,11,12,15,16-dodecahydrocyclopenta[a]phenanthren-12-yl] benzoate |
SMILES (Canonical) | CC1C(C(CC(O1)OC2C(OC(CC2OC)OC3C(OC(CC3OC)OC4C(OC(CC4O)OC5CCC6(C(C5)CCC7(C6CC(C8(C7(CCC8(C(=O)C)O)O)C)OC(=O)C9=CC=CC=C9)O)C)C)C)C)OC)O |
SMILES (Isomeric) | CC1C(C(CC(O1)OC2C(OC(CC2OC)OC3C(OC(CC3OC)OC4C(OC(CC4O)OC5CCC6(C(C5)CCC7(C6CC(C8(C7(CCC8(C(=O)C)O)O)C)OC(=O)C9=CC=CC=C9)O)C)C)C)C)OC)O |
InChI | InChI=1S/C55H84O19/c1-28-46(58)37(63-8)24-43(66-28)73-48-31(4)69-45(26-39(48)65-10)74-49-30(3)68-44(25-38(49)64-9)72-47-29(2)67-42(23-36(47)57)70-35-17-18-51(6)34(22-35)16-19-54(61)40(51)27-41(71-50(59)33-14-12-11-13-15-33)52(7)53(60,32(5)56)20-21-55(52,54)62/h11-15,28-31,34-49,57-58,60-62H,16-27H2,1-10H3 |
InChI Key | BQVWGGMOZAMLJJ-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C55H84O19 |
Molecular Weight | 1049.20 g/mol |
Exact Mass | 1048.56068045 g/mol |
Topological Polar Surface Area (TPSA) | 246.00 Ų |
XlogP | 3.50 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.52% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.27% | 86.33% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.80% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 90.14% | 98.95% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 89.73% | 99.23% |
CHEMBL5028 | O14672 | ADAM10 | 88.30% | 97.50% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.21% | 97.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.20% | 100.00% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 87.64% | 90.17% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.59% | 89.00% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 86.55% | 94.62% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.39% | 95.56% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 85.77% | 97.14% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 85.75% | 91.07% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 85.38% | 94.23% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 84.96% | 94.08% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 83.59% | 91.49% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.25% | 95.89% |
CHEMBL2782 | P35610 | Acyl coenzyme A:cholesterol acyltransferase 1 | 83.17% | 91.65% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 82.80% | 83.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.80% | 94.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.34% | 96.00% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.33% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Asclepias curassavica |
PubChem | 163043946 |
LOTUS | LTS0163851 |
wikiData | Q104944600 |